diff options
Diffstat (limited to 'CompilerDriver/cc2/source/parse.h')
| -rw-r--r-- | CompilerDriver/cc2/source/parse.h | 9263 |
1 files changed, 9263 insertions, 0 deletions
diff --git a/CompilerDriver/cc2/source/parse.h b/CompilerDriver/cc2/source/parse.h new file mode 100644 index 0000000..e8e6daf --- /dev/null +++ b/CompilerDriver/cc2/source/parse.h @@ -0,0 +1,9263 @@ + +// Copyright (c) Herb Sutter +// SPDX-License-Identifier: CC-BY-NC-ND-4.0 + +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +// THE SOFTWARE. + + +//=========================================================================== +// Parser +//=========================================================================== + +#ifndef CPP2_PARSE_H +#define CPP2_PARSE_H + +#include "lex.h" +#include <memory> +#include <variant> +#include <iostream> + + +namespace cpp2 { + +auto violates_lifetime_safety = false; + +//----------------------------------------------------------------------- +// Operator categorization +// + +//G prefix-operator: +//G one of '!' '-' '+' +//GT parameter-direction +//G +auto is_prefix_operator(token const& tok) + -> bool +{ + //if (to_passing_style(tok) != passing_style::invalid) { + // return true; + //} + + switch (tok.type()) { + break;case lexeme::Not: + case lexeme::Minus: + case lexeme::Plus: + return true; + break;default: + return false; + } +} + + +//G postfix-operator: +//G one of '++' '--' '*' '&' '~' '$' '...' +//G +auto is_postfix_operator(lexeme l) + -> bool +{ + switch (l) { + break;case lexeme::PlusPlus: + case lexeme::MinusMinus: + case lexeme::Multiply: + case lexeme::Ampersand: + case lexeme::Tilde: + case lexeme::Dollar: + case lexeme::Ellipsis: + return true; + break;default: + return false; + } +} + + +//G assignment-operator: +//G one of '=' '*=' '/=' '%=' '+=' '-=' '>>=' '<<=' '&=' '^=' '|=' +//G +auto is_assignment_operator(lexeme l) + -> bool +{ + switch (l) { + break;case lexeme::Assignment: + case lexeme::MultiplyEq: + case lexeme::SlashEq: + case lexeme::ModuloEq: + case lexeme::PlusEq: + case lexeme::MinusEq: + case lexeme::RightShiftEq: + case lexeme::LeftShiftEq: + case lexeme::AmpersandEq: + case lexeme::CaretEq: + case lexeme::PipeEq: + return true; + break;default: + return false; + } +} + + +//----------------------------------------------------------------------- +// +// Parse tree node types +// +//----------------------------------------------------------------------- +// + +//----------------------------------------------------------------------- +// try_visit +// +// Helper to visit whatever is in a variant where each +// alternative is a smart pointer +// +template <int I> +auto try_visit(auto& variant, auto& visitor, int depth) + -> void +{ + if (variant.index() == I) { + auto const& s = std::get<I>(variant); + assert (s); + s->visit(visitor, depth+1); + } +} + + +struct expression_list_node; +struct id_expression_node; +struct declaration_node; +struct inspect_expression_node; +struct literal_node; +struct template_argument; + + +struct primary_expression_node +{ + enum active { empty=0, identifier, expression_list, id_expression, declaration, inspect, literal }; + std::variant< + std::monostate, + token const*, + std::unique_ptr<expression_list_node>, + std::unique_ptr<id_expression_node>, + std::unique_ptr<declaration_node>, + std::unique_ptr<inspect_expression_node>, + std::unique_ptr<literal_node> + > expr; + // Cache to work around <https://github.com/llvm/llvm-project/issues/73336>. + bool expression_list_is_fold_expression = false; + + + // API + // + auto is_fold_expression() const + -> bool; + + auto is_identifier() const + -> bool; + + auto is_id_expression() const + -> bool; + + auto is_expression_list() const + -> bool; + + auto get_expression_list() const + -> expression_list_node const*; + + auto is_literal() const + -> bool; + + auto template_arguments() const -> std::vector<template_argument> const&; + + auto get_token() const -> token const*; + + auto to_string() const + -> std::string; + + // Internals + // + auto position() const -> source_position; + auto visit(auto& v, int depth) -> void; +}; + + +struct literal_node { + token const* literal = {}; + token const* user_defined_suffix = {}; + + // API + // + auto get_token() const + -> token const* + { + return literal; + } + + auto to_string() const + -> std::string + { + assert (literal); + auto ret = literal->to_string(); + if (user_defined_suffix) { + ret += user_defined_suffix->to_string(); + } + return ret; + } + + // Internals + // + auto position() const + -> source_position + { + assert (literal); + return literal->position(); + } + + auto visit(auto& v, int depth) -> void + { + v.start(*this, depth); + assert (literal); + literal->visit(v, depth+1); + if (user_defined_suffix) { + user_defined_suffix->visit(v, depth+1); + } + v.end(*this, depth); + } +}; + + +struct postfix_expression_node; + +struct prefix_expression_node +{ + std::vector<token const*> ops; + std::unique_ptr<postfix_expression_node> expr; + + // API + // + auto is_fold_expression() const + -> bool; + + auto is_identifier() const + -> bool; + + auto is_id_expression() const + -> bool; + + auto is_expression_list() const + -> bool; + + auto get_expression_list() const + -> expression_list_node const*; + + auto get_postfix_expression_node() const + -> postfix_expression_node * + { + assert(expr); + return expr.get(); + } + + auto is_literal() const + -> bool; + + auto is_result_a_temporary_variable() const -> bool; + + auto to_string() const + -> std::string; + + // Internals + // + auto position() const -> source_position; + auto visit(auto& v, int depth) -> void; +}; + + +struct expression_node; + + +template< + String Name, + typename Term +> +struct binary_expression_node +{ + std::unique_ptr<Term> expr; + expression_node const* my_expression = {}; + + binary_expression_node(); + + struct term + { + token const* op; + std::unique_ptr<Term> expr; + }; + std::vector<term> terms; + + + // API + // + auto is_fold_expression() const + -> bool + { + // This is a fold-expression if any subexpression + // has an identifier named "..." + auto ret = expr->is_fold_expression(); + for (auto& x : terms) { + ret |= x.expr->is_fold_expression(); + } + return ret; + } + + auto lhs_is_id_expression() const + -> bool + { + return expr->is_id_expression(); + } + + auto is_standalone_expression() const + -> bool; + + auto terms_size() const + -> int + { + return std::ssize(terms); + } + + auto is_identifier() const + -> bool + { + return terms.empty() && expr->is_identifier(); + } + + auto is_id_expression() const + -> bool + { + return terms.empty() && expr->is_id_expression(); + } + + auto is_expression_list() const + -> bool + { + return terms.empty() && expr->is_expression_list(); + } + + auto get_expression_list() const + -> expression_list_node const* + { + if (is_expression_list()) { + return expr->get_expression_list(); + } + return {}; + } + + auto is_literal() const + -> bool + { + return terms.empty() && expr->is_literal(); + } + + // Get left-hand postfix-expression + auto get_postfix_expression_node() const + -> postfix_expression_node * + { + assert(expr); + return expr->get_postfix_expression_node(); + } + + // Get first right-hand postfix-expression, if there is one + auto get_second_postfix_expression_node() const + -> postfix_expression_node * + { + if (!terms.empty()) { + assert(terms.front().expr); + return terms.front().expr->get_postfix_expression_node(); + } + // else + return {}; + } + + // "Simple" means binary (size>0) and not chained (size<2) + struct get_lhs_rhs_if_simple_binary_expression_with_ret { + postfix_expression_node* lhs; + Term* rhs; + }; + auto get_lhs_rhs_if_simple_binary_expression_with(lexeme op) const + -> get_lhs_rhs_if_simple_binary_expression_with_ret + { + if ( + std::ssize(terms) == 1 + && terms[0].op->type() == op + ) + { + return { + get_postfix_expression_node(), + terms.front().expr.get() + }; + } + // Else + return { nullptr, nullptr }; + } + + auto is_result_a_temporary_variable() const -> bool { + if constexpr (std::string_view(Name.value) == "assignment") { + assert(expr); + return expr->is_result_a_temporary_variable(); + } else { + if (terms.empty()) { + assert(expr); + return expr->is_result_a_temporary_variable(); + } else { + return true; + } + } + } + + auto to_string() const + -> std::string + { + assert (expr); + auto ret = expr->to_string(); + for (auto const& x : terms) { + assert (x.op); + ret += " " + x.op->to_string(); + assert (x.expr); + ret += " " + x.expr->to_string(); + } + return ret; + } + + + // Internals + // + auto position() const + -> source_position + { + assert (expr); + return expr->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + assert (expr); + expr->visit(v, depth+1); + for (auto const& x : terms) { + assert (x.op); + v.start(*x.op, depth+1); + assert (x.expr); + x.expr->visit(v, depth+1); + } + v.end(*this, depth); + } +}; + + +struct is_as_expression_node; + +using multiplicative_expression_node = binary_expression_node< "multiplicative" , is_as_expression_node >; +using additive_expression_node = binary_expression_node< "additive" , multiplicative_expression_node >; +using shift_expression_node = binary_expression_node< "shift" , additive_expression_node >; +using compare_expression_node = binary_expression_node< "compare" , shift_expression_node >; +using relational_expression_node = binary_expression_node< "relational" , compare_expression_node >; +using equality_expression_node = binary_expression_node< "equality" , relational_expression_node >; +using bit_and_expression_node = binary_expression_node< "bit-and" , equality_expression_node >; +using bit_xor_expression_node = binary_expression_node< "bit-xor" , bit_and_expression_node >; +using bit_or_expression_node = binary_expression_node< "bit-or" , bit_xor_expression_node >; +using logical_and_expression_node = binary_expression_node< "logical-and" , bit_or_expression_node >; +using logical_or_expression_node = binary_expression_node< "logical-or" , logical_and_expression_node >; +using assignment_expression_node = binary_expression_node< "assignment" , logical_or_expression_node >; + + +struct assignment_expression_lhs_rhs { + postfix_expression_node* lhs; + logical_or_expression_node* rhs; +}; + + +struct expression_statement_node; + +struct expression_node +{ + static inline std::vector<expression_node*> current_expressions = {}; + + std::unique_ptr<assignment_expression_node> expr; + int num_subexpressions = 0; + expression_statement_node const* my_statement = {}; + + expression_node(); + + // API + // + auto is_fold_expression() const + -> bool + { + // This is a fold-expression if any subexpression + // has an identifier named "..." + return expr->is_fold_expression(); + } + + auto is_standalone_expression() const + -> bool; + + auto subexpression_count() const + -> int + { + return num_subexpressions; + } + + auto is_identifier() const + -> bool + { + return expr->is_identifier(); + } + + auto is_id_expression() const + -> bool + { + return expr->is_id_expression(); + } + + auto is_expression_list() const + -> bool + { + return expr->is_expression_list(); + } + + auto get_expression_list() const + -> expression_list_node const* + { + if (is_expression_list()) { + return expr->get_expression_list(); + } + return {}; + } + + auto is_literal() const + -> bool + { + return expr->is_literal(); + } + + auto get_lhs_rhs_if_simple_assignment() const + -> assignment_expression_lhs_rhs; + + auto to_string() const + -> std::string + { + assert (expr); + return expr->to_string(); + } + + // Internals + // + auto position() const -> source_position + { + assert (expr); + return expr->position(); + } + + auto visit(auto& v, int depth) -> void + { + v.start(*this, depth); + assert (expr); + expr->visit(v, depth+1); + v.end(*this, depth); + } +}; + + +template< + String Name, + typename Term +> +binary_expression_node<Name, Term>::binary_expression_node() { + if (!expression_node::current_expressions.empty()) { + my_expression = expression_node::current_expressions.back(); + } +} + + +template< + String Name, + typename Term +> +auto binary_expression_node<Name, Term>::is_standalone_expression() const + -> bool +{ + return + my_expression + && my_expression->is_standalone_expression() + ; +} + + +enum class passing_style { in=0, copy, inout, out, move, forward, invalid }; +auto to_passing_style(token const& t) -> passing_style { + if (t.type() == lexeme::Identifier) { + if (t == "in" ) { return passing_style::in; } + if (t == "copy" ) { return passing_style::copy; } + if (t == "inout" ) { return passing_style::inout; } + if (t == "out" ) { return passing_style::out; } + if (t == "move" ) { return passing_style::move; } + if (t == "forward") { return passing_style::forward; } + } + return passing_style::invalid; +} +auto to_string_view(passing_style pass) -> std::string_view { + switch (pass) { + break;case passing_style::in : return "in"; + break;case passing_style::copy : return "copy"; + break;case passing_style::inout : return "inout"; + break;case passing_style::out : return "out"; + break;case passing_style::move : return "move"; + break;case passing_style::forward: return "forward"; + break;default : return "INVALID passing_style"; + } +} + + +struct expression_list_node +{ + token const* open_paren = {}; + token const* close_paren = {}; + bool inside_initializer = false; + + struct term { + passing_style pass = {}; + std::unique_ptr<expression_node> expr; + + auto visit(auto& v, int depth) -> void + { + v.start(*this, depth); + assert(expr); + expr->visit(v, depth+1); + v.end(*this, depth); + } + }; + std::vector< term > expressions; + + + // API + // + auto is_fold_expression() const + -> bool + { + // This is a fold-expression if any subexpression + // has an identifier named "..." + auto ret = false; + for (auto& x : expressions) { + ret |= x.expr->is_fold_expression(); + } + return ret; + } + + + // Internals + // + auto position() const + -> source_position + { + // Make sure this got set + assert (open_paren); + return open_paren->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + for (auto& x : expressions) { + x.visit(v, depth+1); + } + v.end(*this, depth); + } +}; + +auto primary_expression_node::is_identifier() const + -> bool +{ + return expr.index() == identifier; +} + +auto primary_expression_node::is_id_expression() const + -> bool +{ + return expr.index() == id_expression; +} + +auto primary_expression_node::is_expression_list() const + -> bool +{ + return expr.index() == expression_list; +} + +auto primary_expression_node::get_expression_list() const + -> expression_list_node const* +{ + if (is_expression_list()) { + return std::get<expression_list>(expr).get(); + } + return {}; +} + +auto primary_expression_node::is_literal() const + -> bool +{ + return expr.index() == literal; +} + + +struct expression_statement_node +{ + static inline std::vector<expression_statement_node*> current_expression_statements = {}; + + std::unique_ptr<expression_node> expr; + bool has_semicolon = false; + + // API + // + auto subexpression_count() const + -> int + { + assert (expr); + return expr->subexpression_count(); + } + + auto to_string() const + -> std::string + { + assert (expr); + return expr->to_string(); + } + + // Internals + // + auto position() const + -> source_position + { + assert (expr); + return expr->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + assert (expr); + expr->visit(v, depth+1); + v.end(*this, depth); + } +}; + + +auto expression_node::is_standalone_expression() const + -> bool +{ + return + my_statement + && my_statement->subexpression_count() == subexpression_count() + ; +} + + +struct capture { + postfix_expression_node* capture_expr; + std::string cap_sym = {}; + std::string str = {}; + std::string str_suppressed_move = {}; + auto operator==(postfix_expression_node* p) { return capture_expr == p; } +}; + +struct capture_group { + std::vector<capture> members; + + auto add(postfix_expression_node* p) + -> void + { + members.push_back({p}); + } + + auto remove(postfix_expression_node* p) + -> void; + + ~capture_group(); +}; + + +struct postfix_expression_node +{ + std::unique_ptr<primary_expression_node> expr; + + struct term + { + token const* op; + + // This is used if *op is . - can be null + std::unique_ptr<id_expression_node> id_expr = {}; + + // These are used if *op is [ or ( - can be null + std::unique_ptr<expression_list_node> expr_list = {}; + token const* op_close = {}; + }; + std::vector<term> ops; + capture_group* cap_grp = {}; + + ~postfix_expression_node(); + + // API + // + auto is_fold_expression() const + -> bool + { + // This is a fold-expression if any subexpression + // has an identifier named "..." + return expr->is_fold_expression(); + } + + auto is_identifier() const + -> bool + { + return ops.empty() && expr->is_identifier(); + } + + auto is_id_expression() const + -> bool + { + return ops.empty() && expr->is_id_expression(); + } + + auto is_expression_list() const + -> bool + { + return ops.empty() && expr->is_expression_list(); + } + + auto get_expression_list() const + -> expression_list_node const* + { + if (is_expression_list()) { + return expr->get_expression_list(); + } + return {}; + } + + auto is_literal() const + -> bool + { + return ops.empty() && expr->is_literal(); + } + + auto get_first_token_ignoring_this() const + -> token const*; + + auto is_result_a_temporary_variable() const -> bool { + if (ops.empty()) { + return false; + } else { + return (ops.front().op->type() == lexeme::Ampersand + || ops.front().op->type() == lexeme::Tilde); + } + } + + auto to_string() const + -> std::string; + + // Internals + // + auto position() const -> source_position + { + assert (expr); + return expr->position(); + } + + auto visit(auto& v, int depth) -> void; +}; + +auto prefix_expression_node::is_fold_expression() const + -> bool +{ + // This is a fold-expression if any subexpression + // has an identifier named "..." + return expr->is_fold_expression(); +} + +auto prefix_expression_node::is_identifier() const + -> bool +{ + return ops.empty() && expr->is_identifier(); +} + +auto prefix_expression_node::is_id_expression() const + -> bool +{ + return ops.empty() && expr->is_id_expression(); +} + +auto prefix_expression_node::is_expression_list() const + -> bool +{ + return ops.empty() && expr->is_expression_list(); +} + +auto prefix_expression_node::get_expression_list() const + -> expression_list_node const* +{ + if (is_expression_list()) { + return expr->get_expression_list(); + } + return {}; +} + +auto prefix_expression_node::is_literal() const + -> bool +{ + return ops.empty() && expr->is_literal(); +} + +auto prefix_expression_node::is_result_a_temporary_variable() const -> bool { + if (ops.empty()) { + return expr->is_result_a_temporary_variable(); + } else { + return true; + } +} + + +auto expression_node::get_lhs_rhs_if_simple_assignment() const + -> assignment_expression_lhs_rhs +{ + auto ret = expr->get_lhs_rhs_if_simple_binary_expression_with(lexeme::Assignment); + return { ret.lhs, ret.rhs }; +} + + +auto capture_group::remove(postfix_expression_node* p) + -> void +{ + p->cap_grp = {}; + auto old_size = members.size(); + std::erase(members, p); + assert (members.size() == old_size-1); +} + + +capture_group::~capture_group() +{ + assert (members.empty()); + // We shouldn't need to do this: + // while (!members.empty()) { + // remove(members.front().capture_expr); + // } + // if the capture_group outlives the tree of things that can point to it + // => each node with a capture_group should declare it as the first member + // before any other node that could own a postfix_expression that could + // point back up to that capture_group +} + + +auto prefix_expression_node::to_string() const + -> std::string +{ + auto ret = std::string{}; + + for (auto const& x : ops) { + assert (x); + ret += x->as_string_view(); + } + + assert (expr); + return ret + expr->to_string(); +} + + +auto prefix_expression_node::position() const + -> source_position +{ + if (std::ssize(ops) > 0) { + return ops.front()->position(); + } + assert (expr); + return expr->position(); +} + + +auto prefix_expression_node::visit(auto& v, int depth) + -> void +{ + v.start(*this, depth); + for (auto const& x : ops) { + assert (x); + v.start(*x, depth+1); + } + assert (expr); + expr->visit(v, depth+1); + v.end(*this, depth); +} + + +struct type_id_node; +struct template_args_tag { }; + +struct template_argument +{ + enum active { empty=0, expression, type_id }; + source_position comma; + std::variant< + std::monostate, + std::unique_ptr<expression_node>, + std::unique_ptr<type_id_node> + > arg; + + auto to_string() const + -> std::string; +}; + +// Used by functions that must return a reference to an empty arg list +inline std::vector<template_argument> const no_template_args; + +struct unqualified_id_node +{ + token const* identifier = {}; // required + + // These are used only if it's a template-id + source_position open_angle = {}; + source_position close_angle = {}; + + std::vector<template_argument> template_args; + + auto template_arguments() const + -> std::vector<template_argument> const& + { + return template_args; + } + + auto get_token() const + -> token const* + { + if (open_angle == source_position{}) { + assert (identifier); + return identifier; + } + // else + return {}; + } + + auto to_string() const + -> std::string; + + auto position() const + -> source_position + { + assert (identifier); + return identifier->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + assert (identifier); + v.start(*identifier, depth+1); + + if (open_angle != source_position{}) { + // Inform the visitor that this is a template args list + v.start(template_args_tag{}, depth); + assert(open_angle != source_position{}); + assert(close_angle != source_position{}); + assert(template_args.empty() + || template_args.front().comma == source_position{}); + for (auto& a : template_args) { + try_visit<template_argument::expression>(a.arg, v, depth+1); + try_visit<template_argument::type_id >(a.arg, v, depth+1); + } + v.end(template_args_tag{}, depth); + } + + v.end(*this, depth); + } +}; + + +struct qualified_id_node +{ + struct term { + token const* scope_op; + std::unique_ptr<unqualified_id_node> id = {}; + + term( token const* o ) : scope_op{o} { } + }; + std::vector<term> ids; + + auto template_arguments() const + -> std::vector<template_argument> const& + { + return ids.back().id->template_arguments(); + } + + auto get_token() const + -> token const* + { + if ( + std::ssize(ids) == 1 + && !ids.front().scope_op + ) + { + assert (ids.front().id); + return ids.front().id->get_token(); + } + // else + return {}; + } + + auto to_string() const + -> std::string + { + auto ret = std::string{}; + for (auto& term : ids) { + if (term.scope_op) { + ret += term.scope_op->as_string_view(); + } + assert (term.id); + ret += term.id->to_string(); + } + return ret; + } + + auto get_first_token() const + -> token const* + { + assert ( + !ids.empty() + && ids.front().id + ); + return ids.front().id->get_token(); + } + + auto position() const + -> source_position + { + assert (!ids.empty()); + if (ids.front().scope_op) { + return ids.front().scope_op->position(); + } + else { + assert (ids.front().id); + return ids.front().id->position(); + } + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + for (auto const& x : ids) { + if (x.scope_op) { + x.scope_op->visit(v, depth+1); + } + assert(x.id); + x.id->visit(v, depth+1); + } + v.end(*this, depth); + } +}; + + +struct type_id_node +{ + source_position pos; + + std::vector<token const*> pc_qualifiers; + token const* address_of = {}; + token const* dereference_of = {}; + int dereference_cnt = {}; + token const* suspicious_initialization = {}; + + enum active { empty=0, qualified, unqualified, keyword }; + std::variant< + std::monostate, + std::unique_ptr<qualified_id_node>, + std::unique_ptr<unqualified_id_node>, + token const* + > id; + + auto is_wildcard() const + -> bool + { + return + id.index() == type_id_node::empty + || (get_token() && *get_token() == "_") + ; + } + + auto is_pointer_qualified() const + -> bool + { + for (auto q : pc_qualifiers) { + if (q->type() == lexeme::Multiply) { + return true; + } + } + return false; + } + + auto is_concept() const + -> bool + { + auto tok = get_token(); + return tok && *tok == "concept"; + } + + auto template_arguments() const + -> std::vector<template_argument> const& + { + if (id.index() == unqualified) { + return std::get<unqualified>(id)->template_arguments(); + } + // else + return std::get<qualified>(id)->template_arguments(); + } + + auto to_string() const + -> std::string + { + switch (id.index()) { + break;case empty: + return {}; + break;case qualified: + return std::get<qualified>(id)->to_string(); + break;case unqualified: + return std::get<unqualified>(id)->to_string(); + break;case keyword: + return std::get<keyword>(id)->to_string(); + break;default: + assert(!"ICE: invalid type_id state"); + } + // else + return {}; + } + + auto get_token() const + -> token const* + { + switch (id.index()) { + break;case empty: + return {}; + break;case qualified: + return {}; + break;case unqualified: + return get<unqualified>(id)->get_token(); + break;case keyword: + return get<keyword>(id); + break;default: + assert(!"ICE: invalid type_id state"); + } + // else + return {}; + } + + auto position() const + -> source_position + { + return pos; + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + for (auto q : pc_qualifiers) { + v.start(*q, depth+1); + } + try_visit<qualified >(id, v, depth); + try_visit<unqualified>(id, v, depth); + try_visit<keyword >(id, v, depth); + v.end(*this, depth); + } +}; + +auto unqualified_id_node::to_string() const + -> std::string +{ + assert(identifier); + auto ret = identifier->to_string(); + if (open_angle != source_position{}) { + auto separator = std::string{"<"}; + for (auto& t : template_args) { + ret += separator; + assert(t.arg.index() != template_argument::empty); + if (t.arg.index() == template_argument::expression) { + ret += std::get<template_argument::expression>(t.arg)->to_string(); + } + else if (t.arg.index() == template_argument::type_id) { + ret += std::get<template_argument::type_id>(t.arg)->to_string(); + } + separator = ","; + } + if (std::ssize(template_args) > 0) { + ret += ">"; + } + } + return ret; +} + +auto template_argument::to_string() const + -> std::string +{ + switch (arg.index()) { + break;case empty: + return {}; + break;case expression: + return std::get<expression>(arg)->to_string(); + break;case type_id: + return std::get<type_id>(arg)->to_string(); + break;default: + assert(!"ICE: invalid template_argument state"); + } + // else + return {}; +} + + +struct is_as_expression_node +{ + std::unique_ptr<prefix_expression_node> expr; + + struct term + { + token const* op = {}; + + // This is used if *op is a type - can be null + std::unique_ptr<type_id_node> type = {}; + + // This is used if *op is an expression - can be null + std::unique_ptr<expression_node> expr = {}; + }; + std::vector<term> ops; + + + // API + // + auto is_fold_expression() const + -> bool + { + // This is a fold-expression if any subexpression + // has an identifier named "..." + return expr->is_fold_expression(); + } + + auto is_identifier() const + -> bool + { + return ops.empty() && expr->is_identifier(); + } + + auto is_id_expression() const + -> bool + { + return ops.empty() && expr->is_id_expression(); + } + + auto is_expression_list() const + -> bool + { + return ops.empty() && expr->is_expression_list(); + } + + auto get_expression_list() const + -> expression_list_node const* + { + if (is_expression_list()) { + return expr->get_expression_list(); + } + return {}; + } + + auto is_literal() const + -> bool + { + return ops.empty() && expr->is_literal(); + } + + auto get_postfix_expression_node() const + -> postfix_expression_node * + { + assert(expr); + return expr->get_postfix_expression_node(); + } + + auto is_result_a_temporary_variable() const -> bool { + if (ops.empty()) { + assert(expr); + return expr->is_result_a_temporary_variable(); + } else { + return true; + } + } + + auto to_string() const + -> std::string + { + assert (expr); + auto ret = expr->to_string(); + for (auto const& x : ops) { + assert (x.op); + ret += " " + x.op->to_string(); + if (x.type) { + ret += " " + x.type->to_string(); + } + if (x.expr) { + ret += " " + x.expr->to_string(); + } + } + return ret; + } + + // Internals + // + auto position() const + -> source_position + { + assert (expr); + return expr->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + assert (expr); + expr->visit(v, depth+1); + for (auto const& x : ops) { + assert (x.op); + v.start(*x.op, depth+1); + if (x.type) { + x.type->visit(v, depth+1); + } + if (x.expr) { + x.expr->visit(v, depth+1); + } + } + v.end(*this, depth); + } +}; + + +expression_node::expression_node() +{ + if (!expression_statement_node::current_expression_statements.empty()) { + my_statement = expression_statement_node::current_expression_statements.back(); + } +} + + +struct id_expression_node +{ + source_position pos; + + enum active { empty=0, qualified, unqualified }; + std::variant< + std::monostate, + std::unique_ptr<qualified_id_node>, + std::unique_ptr<unqualified_id_node> + > id; + + auto template_arguments() const + -> std::vector<template_argument> const& + { + if (is_unqualified()) { + return std::get<unqualified>(id)->template_arguments(); + } + // else + return std::get<qualified>(id)->template_arguments(); + } + + auto is_fold_expression() const + -> bool + { + // This is a fold-expression if any subexpression has + // has an identifier named "..." + auto tok = get_token(); + return tok && *tok == "..."; + } + + auto is_empty() const + -> bool + { + return id.index() == empty; + } + + auto is_qualified() const + -> bool + { + return id.index() == qualified; + } + + auto is_unqualified() const + -> bool + { + return id.index() == unqualified; + } + + auto get_token() const + -> token const* + { + if (id.index() == unqualified) { + return std::get<unqualified>(id)->get_token(); + } + // else + return {}; + } + + auto to_string() const + -> std::string + { + if (id.index() == qualified) { + return std::get<qualified>(id)->to_string(); + } + else if (id.index() == unqualified) { + return std::get<unqualified>(id)->to_string(); + } + // else + return {}; + } + + auto position() const + -> source_position + { + return pos; + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + try_visit<qualified >(id, v, depth); + try_visit<unqualified>(id, v, depth); + v.end(*this, depth); + } +}; + + +postfix_expression_node::~postfix_expression_node() +{ + if (cap_grp) { + cap_grp->remove(this); + } +} + + +auto primary_expression_node::is_fold_expression() const + -> bool +{ + // This is a fold-expression if any subexpression has + // has an identifier named "..." + switch (expr.index()) { + break;case identifier: + return *std::get<identifier>(expr) == "..."; + break;case expression_list: + return expression_list_is_fold_expression; + break;case id_expression: + return std::get<id_expression>(expr)->is_fold_expression(); + break;default: ; // the others can't contain folds + } + return false; +} + + +auto postfix_expression_node::get_first_token_ignoring_this() const + -> token const* +{ + if ( + expr->get_token() + && *expr->get_token() == "this" + && std::ssize(ops) == 1 + && ops[0].op->type() == lexeme::Dot + ) + { + return ops[0].id_expr->get_token(); + } + return expr->get_token(); +} + + +auto postfix_expression_node::to_string() const + -> std::string +{ + assert (expr); + auto ret = expr->to_string(); + + for (auto const& x : ops) { + assert (x.op); + ret += x.op->as_string_view(); + if (x.id_expr) { + ret += x.id_expr->to_string(); + } + if (x.expr_list) { + return "(*ERROR*) temporary alpha limitation: type metafunctions cannot stringize expressions that involve nested expression-lists, declarations, or inspect expressions"; + } + } + + return ret; +} + + +auto postfix_expression_node::visit(auto& v, int depth) + -> void +{ + v.start(*this, depth); + assert (expr); + expr->visit(v, depth+1); + for (auto const& x : ops) { + assert (x.op); + v.start(*x.op, depth+1); + if (x.id_expr) { + x.id_expr->visit(v, depth+1); + } + if (x.expr_list) { + x.expr_list->visit(v, depth+1); + } + } + v.end(*this, depth); +} + + +struct statement_node; + +struct compound_statement_node +{ + source_position open_brace; + source_position close_brace; + std::vector<std::unique_ptr<statement_node>> statements; + + colno_t body_indent = 0; + + compound_statement_node(source_position o = source_position{}); + + auto position() const + -> source_position + { + return open_brace; + } + + auto visit(auto& v, int depth) -> void; +}; + + +struct selection_statement_node +{ + bool is_constexpr = false; + token const* identifier = {}; + source_position else_pos; + std::unique_ptr<logical_or_expression_node> expression; + std::unique_ptr<compound_statement_node> true_branch; + std::unique_ptr<compound_statement_node> false_branch; + bool has_source_false_branch = false; + + auto position() const + -> source_position + { + assert (identifier); + return identifier->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + assert (identifier); + v.start(*identifier, depth+1); + assert (expression); + expression->visit(v, depth+1); + assert (true_branch); + true_branch->visit(v, depth+1); + if (false_branch) { + false_branch->visit(v, depth+1); + } + v.end(*this, depth); + } +}; + + +struct parameter_declaration_node; + +struct iteration_statement_node +{ + token const* label = {}; + token const* identifier = {}; + std::unique_ptr<assignment_expression_node> next_expression; // if used, else null + std::unique_ptr<logical_or_expression_node> condition; // used for "do" and "while", else null + std::unique_ptr<compound_statement_node> statements; // used for "do" and "while", else null + std::unique_ptr<expression_node> range; // used for "for", else null + std::unique_ptr<parameter_declaration_node> parameter; // used for "for", else null + std::unique_ptr<statement_node> body; // used for "for", else null + bool for_with_in = false;// used for "for," says whether loop variable is 'in' + + auto position() const + -> source_position + { + if (label) { + return label->position(); + } + assert(identifier); + return identifier->position(); + } + + auto visit(auto& v, int depth) + -> void; +}; + + +struct return_statement_node +{ + token const* identifier = {}; + std::unique_ptr<expression_node> expression; + + auto position() const + -> source_position + { + assert(identifier); + return identifier->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + if (expression) { + expression->visit(v, depth+1); + } + v.end(*this, depth); + } +}; + + +struct alternative_node +{ + std::unique_ptr<unqualified_id_node> name; + token const* is_as_keyword = {}; + + // One of these will be used + std::unique_ptr<type_id_node> type_id; + std::unique_ptr<postfix_expression_node> value; + + source_position equal_sign; + std::unique_ptr<statement_node> statement; + + auto position() const + -> source_position + { + assert(is_as_keyword); + return is_as_keyword->position(); + } + + auto visit(auto& v, int depth) + -> void; +}; + + +struct inspect_expression_node +{ + bool is_constexpr = false; + token const* identifier = {}; + std::unique_ptr<expression_node> expression; + std::unique_ptr<type_id_node> result_type; + source_position open_brace; + source_position close_brace; + + std::vector<std::unique_ptr<alternative_node>> alternatives; + + auto position() const + -> source_position + { + assert(identifier); + return identifier->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + assert (identifier); + v.start(*identifier, depth+1); + assert (expression); + expression->visit(v, depth+1); + if (result_type) { + result_type->visit(v, depth+1); + } + for (auto&& alt : alternatives) { + alt->visit(v, depth+1); + } + v.end(*this, depth); + } +}; + + +struct contract_node +{ + // Declared first, because it should outlive any owned + // postfix_expressions that could refer to it + capture_group captures; + + source_position open_bracket; + token const* kind = {}; + std::unique_ptr<id_expression_node> group; + std::vector<std::unique_ptr<id_expression_node>> flags; + std::unique_ptr<logical_or_expression_node> condition; + std::unique_ptr<expression_node> message = {}; + + contract_node( source_position pos ) + : open_bracket{pos} + { } + + auto position() const + -> source_position + { + return open_bracket; + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + + assert(kind); + kind->visit(v, depth+1); + + if (group) { + group->visit(v, depth+1); + } + + for (auto const& f : flags) { + f->visit(v, depth+1); + } + + assert(condition); + condition->visit(v, depth+1); + + if (message) { + message->visit(v, depth+1); + } + + v.end(*this, depth); + } +}; + + +struct jump_statement_node +{ + token const* keyword; + token const* label; + + auto position() const + -> source_position + { + assert(keyword); + return keyword->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + if (keyword) { + keyword->visit(v, depth+1); + } + if (label) { + label->visit(v, depth+1); + } + v.end(*this, depth); + } +}; + + +struct using_statement_node +{ + token const* keyword = {}; + bool for_namespace = false; + std::unique_ptr<id_expression_node> id; + + auto position() const + -> source_position + { + assert(keyword); + return keyword->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + assert(id); + id->visit(v, depth+1); + v.end(*this, depth); + } +}; + + +struct parameter_declaration_list_node; + +struct statement_node +{ + std::unique_ptr<parameter_declaration_list_node> parameters; + compound_statement_node* compound_parent = nullptr; + + statement_node(compound_statement_node* compound_parent_ = nullptr); + + enum active { expression=0, compound, selection, declaration, return_, iteration, using_, contract, inspect, jump }; + std::variant< + std::unique_ptr<expression_statement_node>, + std::unique_ptr<compound_statement_node>, + std::unique_ptr<selection_statement_node>, + std::unique_ptr<declaration_node>, + std::unique_ptr<return_statement_node>, + std::unique_ptr<iteration_statement_node>, + std::unique_ptr<using_statement_node>, + std::unique_ptr<contract_node>, + std::unique_ptr<inspect_expression_node>, + std::unique_ptr<jump_statement_node> + > statement; + + bool emitted = false; // a note field that's used during lowering to Cpp1 + + bool marked_for_removal = false; // for use during metafunctions which may replace members + + // API + // + auto is_expression () const -> bool { return statement.index() == expression; } + auto is_compound () const -> bool { return statement.index() == compound; } + auto is_selection () const -> bool { return statement.index() == selection; } + auto is_declaration() const -> bool { return statement.index() == declaration; } + auto is_return () const -> bool { return statement.index() == return_; } + auto is_iteration () const -> bool { return statement.index() == iteration; } + auto is_using () const -> bool { return statement.index() == using_; } + auto is_contract () const -> bool { return statement.index() == contract; } + auto is_inspect () const -> bool { return statement.index() == inspect; } + auto is_jump () const -> bool { return statement.index() == jump; } + + template<typename Node> + auto get_if() + -> Node* + { + auto pnode = std::get_if<std::unique_ptr<Node>>(&statement); + if (pnode) { + return pnode->get(); + } + // else + return nullptr; + } + + template<typename Node> + auto get_if() const + -> Node const* + { + auto pnode = std::get_if<std::unique_ptr<Node>>(&statement); + if (pnode) { + return pnode->get(); + } + // else + return nullptr; + } + + auto get_lhs_rhs_if_simple_assignment() const + -> assignment_expression_lhs_rhs + { + if (is_expression()) { + return std::get<expression>(statement)->expr->get_lhs_rhs_if_simple_assignment(); + } + // Else + return {}; + } + + auto to_string() const + -> std::string + { + switch (statement.index()) { + break;case expression: + return std::get<expression>(statement)->to_string(); + break;default: + return "(*ERROR*) temporary alpha limitation: type metafunctions cannot stringize expressions that involve initializer statements other than expression-statements"; + } + } + + // Internals + // + auto position() const + -> source_position; + + auto visit(auto& v, int depth) + -> void; +}; + + +auto alternative_node::visit(auto& v, int depth) + -> void +{ + v.start(*this, depth); + if (name) { + v.start(*name, depth+1); + } + assert (is_as_keyword); + v.start(*is_as_keyword, depth+1); + if (type_id) { + type_id->visit(v, depth+1); + } + else { + assert (value); + value->visit(v, depth+1); + } + assert (statement); + statement->visit(v, depth+1); + v.end(*this, depth); +} + + +auto compound_statement_node::visit(auto& v, int depth) + -> void +{ + v.start(*this, depth); + for (auto const& x : statements) { + assert(x); + x->visit(v, depth+1); + } + v.end(*this, depth); +} + + +struct parameter_declaration_node +{ + source_position pos = {}; + passing_style pass = passing_style::in; + int ordinal = 1; + + enum class modifier { none=0, implicit, virtual_, override_, final_ }; + modifier mod = modifier::none; + + std::unique_ptr<declaration_node> declaration; + + // API + // + auto has_name() const + -> bool; + + auto name() const + -> token const*; + + auto has_name(std::string_view) const + -> bool; + + auto direction() const + -> passing_style + { + return pass; + } + + auto is_implicit() const + -> bool + { + return mod == modifier::implicit; + } + + auto is_virtual() const + -> bool + { + return mod == modifier::virtual_; + } + + auto make_virtual() + -> void + { + mod = modifier::virtual_; + } + + auto is_override() const + -> bool + { + return mod == modifier::override_; + } + + auto is_final() const + -> bool + { + return mod == modifier::final_; + } + + auto is_polymorphic() const + -> bool + { + switch (mod) { + break;case modifier::virtual_: + case modifier::override_: + case modifier::final_: + return true; + break;default: + return false; + } + } + + // Internals + // + auto position() const + -> source_position; + + auto visit(auto& v, int depth) + -> void; +}; + + +struct parameter_declaration_list_node +{ + token const* open_paren = {}; + token const* close_paren = {}; + + std::vector<std::unique_ptr<parameter_declaration_node>> parameters; + + // API + // + auto ssize() const -> auto { + return std::ssize(parameters); + } + + auto operator[](int i) + -> parameter_declaration_node* + { + return parameters[i].get(); + } + + auto operator[](int i) const + -> parameter_declaration_node const* + { + return parameters[i].get(); + } + + // Internals + // + auto position() const + -> source_position + { + assert(open_paren); + return open_paren->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + for (auto const& x : parameters) { + assert(x); + x->visit(v, depth+1); + } + v.end(*this, depth); + } +}; + + +auto statement_node::visit(auto& v, int depth) + -> void +{ + v.start(*this, depth); + if (parameters) { + parameters->visit(v, depth+1); + } + try_visit<expression >(statement, v, depth); + try_visit<compound >(statement, v, depth); + try_visit<selection >(statement, v, depth); + try_visit<declaration>(statement, v, depth); + try_visit<return_ >(statement, v, depth); + try_visit<iteration >(statement, v, depth); + try_visit<contract >(statement, v, depth); + try_visit<inspect >(statement, v, depth); + try_visit<jump >(statement, v, depth); + v.end(*this, depth); +} + + +struct function_returns_tag { }; + +struct function_type_node +{ + declaration_node* my_decl; + + std::unique_ptr<parameter_declaration_list_node> parameters; + bool throws = false; + + struct single_type_id { + std::unique_ptr<type_id_node> type; + passing_style pass = passing_style::move; + }; + + enum active { empty = 0, id, list }; + std::variant< + std::monostate, + single_type_id, + std::unique_ptr<parameter_declaration_list_node> + > returns; + + std::vector<std::unique_ptr<contract_node>> contracts; + + function_type_node(declaration_node* decl); + + // API + // + auto has_postconditions() const + -> bool; + + auto is_function_with_this() const + -> bool; + + auto is_virtual_function() const + -> bool; + + auto make_function_virtual() + -> bool; + + auto is_defaultable() const + -> bool; + + auto is_constructor() const + -> bool; + + auto is_default_constructor() const + -> bool; + + auto is_move() const + -> bool; + + auto is_swap() const + -> bool; + + auto is_constructor_with_that() const + -> bool; + + auto is_constructor_with_in_that() const + -> bool; + + auto is_constructor_with_move_that() const + -> bool; + + auto is_comparison() const + -> bool; + + auto is_increment_or_decrement() const + -> bool; + + auto is_compound_assignment() const + -> bool; + + auto is_assignment() const + -> bool; + + auto is_assignment_with_that() const + -> bool; + + auto is_assignment_with_in_that() const + -> bool; + + auto is_assignment_with_move_that() const + -> bool; + + auto is_destructor() const + -> bool; + + auto has_declared_return_type() const + -> bool + { + return returns.index() != empty; + } + + auto has_deduced_return_type() const + -> bool + { + return + returns.index() == empty + || ( + returns.index() == id + && std::get<function_type_node::id>(returns).type->is_wildcard() + ) + ; + } + + auto unnamed_return_type_to_string() const + -> std::string + { + if (auto id = std::get_if<function_type_node::id>(&returns)) { + return (*id).type->to_string(); + } + return {}; + } + + auto has_bool_return_type() const + -> bool + { + if (auto id = std::get_if<function_type_node::id>(&returns)) { + if (auto name = (*id).type->get_token()) { + return *name == "bool"; + } + } + return false; + } + + auto has_non_void_return_type() const + -> bool + { + if (auto id = std::get_if<function_type_node::id>(&returns)) { + if (auto name = (*id).type->get_token()) { + return *name != "void"; + } + } + return returns.index() != empty; + } + + auto parameter_count() const + -> int + { + return std::ssize(parameters->parameters); + } + + auto index_of_parameter_named(std::string_view s) const + -> int + { + auto ret = 0; + for (auto& param : parameters->parameters) { + if (param->has_name(s)) { + return ret; + } + ++ret; + } + return -1; + } + + auto has_parameter_named(std::string_view s) const + -> bool + { + for (auto& param : parameters->parameters) { + if (param->has_name(s)) { + return true; + } + } + return false; + } + + auto has_parameter_with_name_and_pass( + std::string_view s, + passing_style pass + ) const + -> bool + { + for (auto& param : parameters->parameters) { + if ( + param->has_name(s) + && param->pass == pass + ) + { + return true; + } + } + return false; + } + + auto first_parameter_name() const + -> std::string; + + auto nth_parameter_type_name(int n) const + -> std::string; + + auto has_in_parameter_named(std::string_view s) const + -> bool + { + return has_parameter_with_name_and_pass(s, passing_style::in); + } + + auto has_out_parameter_named(std::string_view s) const + -> bool + { + return has_parameter_with_name_and_pass(s, passing_style::out); + } + + auto has_move_parameter_named(std::string_view s) const + -> bool + { + return has_parameter_with_name_and_pass(s, passing_style::move); + } + + // Internals + // + auto position() const + -> source_position + { + assert (parameters); + return parameters->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + assert(parameters); + parameters->visit(v, depth+1); + + if (returns.index() == id) { + auto& r = std::get<id>(returns); + assert(r.type); + r.type->visit(v, depth+1); + } + else if (returns.index() == list) { + auto& r = std::get<list>(returns); + assert(r); + // Inform the visitor that this is a returns list + v.start(function_returns_tag{}, depth); + r->visit(v, depth+1); + v.end(function_returns_tag{}, depth); + } + v.end(*this, depth); + } +}; + + +struct type_node +{ + token const* type; + bool final = false; + + type_node( + token const* t, + bool final_ = false + ) + : type{t} + , final{final_} + { } + + // API + // + auto is_final() const + -> bool + { + return final; + } + + auto make_final() + -> void + { + final = true; + } + + // Internals + // + auto position() const + -> source_position + { + assert(type); + return type->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + v.end(*this, depth); + } +}; + + +struct namespace_node +{ + token const* namespace_; + + namespace_node(token const* ns) : namespace_{ns} { } + + auto position() const + -> source_position + { + assert(namespace_); + return namespace_->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + v.end(*this, depth); + } +}; + + +struct alias_node +{ + token const* type = {}; + std::unique_ptr<type_id_node> type_id; // for objects + + enum active : std::uint8_t { a_type, a_namespace, an_object }; + std::variant< + std::unique_ptr<type_id_node>, + std::unique_ptr<id_expression_node>, + std::unique_ptr<expression_node> + > initializer; + + alias_node( token const* t ) : type{t} { } + + // API + // + auto is_type_alias () const -> bool + { return initializer.index() == a_type; } + auto is_namespace_alias() const -> bool + { return initializer.index() == a_namespace; } + auto is_object_alias () const -> bool + { return initializer.index() == an_object; } + + // Internals + // + auto position() const + -> source_position + { + assert (type); + return type->position(); + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + + try_visit<a_type >(initializer, v, depth+1); + try_visit<a_namespace>(initializer, v, depth+1); + try_visit<an_object >(initializer, v, depth+1); + + v.end(*this, depth); + } +}; + + +enum class accessibility { default_ = 0, public_, protected_, private_ }; + +auto to_string(accessibility a) + -> std::string +{ + switch (a) { + break;case accessibility::public_ : return "public"; + break;case accessibility::protected_: return "protected"; + break;case accessibility::private_ : return "private"; + break;default: assert(a == accessibility::default_); + } + return "default"; +} + + +struct declaration_identifier_tag { }; + +struct declaration_node +{ + // The capture_group is declared first, because it should outlive + // any owned postfix_expressions that could refer to it + capture_group captures; + source_position pos; + bool is_variadic = false; + bool is_constexpr = false; + bool terse_no_equals = false; + std::unique_ptr<unqualified_id_node> identifier; + accessibility access = accessibility::default_; + + enum active : std::uint8_t { a_function, an_object, a_type, a_namespace, an_alias }; + std::variant< + std::unique_ptr<function_type_node>, + std::unique_ptr<type_id_node>, + std::unique_ptr<type_node>, + std::unique_ptr<namespace_node>, + std::unique_ptr<alias_node> + > type; + + std::vector<std::unique_ptr<id_expression_node>> metafunctions; + std::unique_ptr<parameter_declaration_list_node> template_parameters; + source_position requires_pos = {}; + std::unique_ptr<logical_or_expression_node> requires_clause_expression; + + source_position equal_sign = {}; + std::unique_ptr<statement_node> initializer; + + declaration_node* parent_declaration = {}; + statement_node* my_statement = {}; + + // Attributes currently configurable only via metafunction API, + // not directly in the base language grammar + bool member_function_generation = true; + + // Cache some context + bool is_template_parameter = false; + bool is_parameter = false; + + // Constructor + // + declaration_node(declaration_node* parent) + : parent_declaration{parent} + { } + + // API + // + auto type_member_mark_for_removal() + -> bool + { + if (my_statement) { + my_statement->marked_for_removal = true; + return true; + } + return false; + } + + auto type_remove_marked_members() + -> void + { + assert (is_type() && initializer && initializer->is_compound()); + auto compound_stmt = initializer->get_if<compound_statement_node>(); + assert (compound_stmt); + + // Note: This loop is a careful use of the brittle STL "erase" idiom. Do not change this + // loop without carefully ensuring it remains safe against iterator invalidation. + // (Especially don't change this to a for loop with a "++i" iteration-expression.) + auto i = compound_stmt->statements.begin(); + while (i != compound_stmt->statements.end()) + { + if ((*i)->marked_for_removal) { + i = compound_stmt->statements.erase(i); // these two branches ... + } + else { + ++i; // ... must stay together + } + } + } + + auto type_remove_all_members() + -> void + { + assert (is_type() && initializer && initializer->is_compound()); + auto body = initializer->get_if<compound_statement_node>(); + assert (body); + + // Drop all statements in the body, which should self-deregister all our 'captures' + // - (only) statements in the body should have been able to refer to 'captures' + body->statements.clear(); + assert(captures.members.empty()); + } + + auto type_disable_member_function_generation() + -> void + { + member_function_generation = false; + } + + auto object_type() const + -> std::string + { + if (!is_object()) { + return "(*ERROR*) not an object"; + } + // Else + return std::get<an_object>(type)->to_string(); + } + + auto object_initializer() const + -> std::string + { + if (!is_object()) { + return "(*ERROR*) not an object"; + } + else if (initializer) { + return initializer->to_string(); + } + // Else + return ""; + } + + auto get_parent() const + -> declaration_node* + { + return parent_declaration; + } + + auto is_public() const + -> bool + { + return access == accessibility::public_; + } + + auto is_protected() const + -> bool + { + return access == accessibility::protected_; + } + + auto is_private() const + -> bool + { + return access == accessibility::private_; + } + + auto is_default_access() const + -> bool + { + return access == accessibility::default_; + } + +private: + auto set_access(accessibility a) + -> bool + { + if (is_default_access()) { + access = a; + } + return access == a; + } + +public: + auto make_public() + -> bool + { + return set_access( accessibility::public_ ); + } + + auto make_protected() + -> bool + { + return set_access( accessibility::protected_ ); + } + + auto make_private() + -> bool + { + return set_access( accessibility::private_ ); + } + + auto has_name() const + -> bool + { + return + identifier + && identifier->identifier + ; + } + + auto name() const + -> token const* + { + if (!identifier) { + return nullptr; + } + // Else + return identifier->identifier; + } + + auto has_name(std::string_view s) const + -> bool + { + return + has_name() + && *name() == s + ; + } + + auto has_initializer() const + -> bool + { + return initializer != nullptr; + } + + auto parameter_count() const + -> int + { + if (!is_function()) { + return -1; + } + return std::get<a_function>(type)->parameter_count(); + } + + auto index_of_parameter_named(std::string_view s) const + -> int + { + if (!is_function()) { + return -1; + } + return std::get<a_function>(type)->index_of_parameter_named(s); + } + + auto has_parameter_named(std::string_view s) const + -> bool + { + if (!is_function()) { + return false; + } + return std::get<a_function>(type)->has_parameter_named(s); + } + + auto has_in_parameter_named(std::string_view s) const + -> bool + { + if (!is_function()) { + return false; + } + return std::get<a_function>(type)->has_in_parameter_named(s); + } + + auto has_out_parameter_named(std::string_view s) const + -> bool + { + if (!is_function()) { + return false; + } + return std::get<a_function>(type)->has_out_parameter_named(s); + } + + auto has_move_parameter_named(std::string_view s) const + -> bool + { + if (!is_function()) { + return false; + } + return std::get<a_function>(type)->has_move_parameter_named(s); + } + + auto nth_parameter_type_name(int n) const + -> std::string + { + if (!is_function()) { + return ""; + } + return std::get<a_function>(type)->nth_parameter_type_name(n); + } + + auto is_global () const -> bool + { return !parent_declaration; } + + auto is_function () const -> bool + { return type.index() == a_function; } + auto is_object () const -> bool + { return type.index() == an_object; } + auto is_base_object() const -> bool + { return is_object() && has_name("this"); } + auto is_member_object() const -> bool + { return is_object() && !has_name("this"); } + auto is_concept () const -> bool + { return type.index() == an_object && get<an_object>(type)->is_concept(); } + auto is_type () const -> bool + { return type.index() == a_type; } + auto is_namespace() const -> bool + { return type.index() == a_namespace; } + auto is_alias() const -> bool + { return type.index() == an_alias; } + + auto is_type_alias () const -> bool + { return is_alias() && std::get<an_alias>(type)->is_type_alias(); } + auto is_namespace_alias() const -> bool + { return is_alias() && std::get<an_alias>(type)->is_namespace_alias(); } + auto is_object_alias () const -> bool + { return is_alias() && std::get<an_alias>(type)->is_object_alias(); } + + auto is_function_expression () const -> bool + { return is_function() && !identifier; } + + auto is_polymorphic() const // has base types or virtual functions + -> bool + { + for (auto& decl : get_type_scope_declarations()) { + if ( + decl->has_name("this") + || decl->is_virtual_function() + ) + { + return true; + } + } + return false; + } + + // Do we know that this cannot be a copy constructible type? + auto cannot_be_a_copy_constructible_type() const + -> bool + { + // If we're not a type, we're not a copyable type + if (!is_type()) { + return true; + } + + // Else if we're letting Cpp1 generate SMFs, we're likely copyable + if (!member_function_generation) { + return false; + } + + // Else if we have a copy constructor, we're copyable + for (auto& decl : get_type_scope_declarations()) + if (decl->is_constructor_with_that()) + { + return false; + } + + // Else there can't be a copy constructor + return true; + } + + auto parent_is_function () const -> bool + { return parent_declaration && parent_declaration->type.index() == a_function; } + auto parent_is_object () const -> bool + { return parent_declaration && parent_declaration->type.index() == an_object; } + auto parent_is_type () const -> bool + { return parent_declaration && parent_declaration->type.index() == a_type; } + auto parent_is_namespace () const -> bool + { return !parent_declaration || parent_declaration->type.index() == a_namespace; } + auto parent_is_alias () const -> bool + { return parent_declaration && parent_declaration->type.index() == an_alias; } + + auto parent_is_type_alias () const -> bool + { return parent_declaration && parent_declaration->is_alias() && std::get<an_alias>(parent_declaration->type)->is_type_alias(); } + auto parent_is_namespace_alias() const -> bool + { return parent_declaration && parent_declaration->is_alias() && std::get<an_alias>(parent_declaration->type)->is_namespace_alias(); } + auto parent_is_object_alias () const -> bool + { return parent_declaration && parent_declaration->is_alias() && std::get<an_alias>(parent_declaration->type)->is_object_alias(); } + + auto is_inside_global_unnamed_function() const -> bool { + auto parent = parent_declaration; + // Get outside all nested function expressions + while (parent && parent->is_function() && !parent->has_name()) { + parent = parent->parent_declaration; + } + return !parent; + } + + auto parent_is_polymorphic() const -> bool + { return parent_declaration && parent_declaration->is_polymorphic(); } + + enum which { + functions = 1, + objects = 2, + types = 4, + aliases = 8, + all = functions|objects|types|aliases + }; + +private: + // This helper is a const function that delivers pointers + // to non-const... because this is the best way I can + // think of right now to write the following two get_ + // functions (without duplicating their bodies, and + // without resorting to const_casts) + auto gather_type_scope_declarations(which w) const + -> std::vector<declaration_node*> + { + if ( + !is_type() + || !initializer + || !initializer->is_compound() + ) + { + return {}; + } + + auto compound_stmt = initializer->get_if<compound_statement_node>(); + assert (compound_stmt); + + auto ret = std::vector<declaration_node*>{}; + for (auto& o : compound_stmt->statements) + { + auto decl = o->get_if<declaration_node>(); + if (decl) + { + assert( + !decl->is_namespace() + && "ICE: a type shouldn't be able to contain a namespace" + ); + if ( + (w & functions && decl->is_function()) + || (w & objects && decl->is_object() ) + || (w & types && decl->is_type() ) + || (w & aliases && decl->is_alias() ) + ) + { + ret.push_back(decl); + } + } + } + + return ret; + } + +public: + auto get_type_scope_declarations(which w = all) + -> std::vector<declaration_node*> + { + // Only want to return the gather_ results as + // non-const* in a non-const function + return gather_type_scope_declarations(w); + } + + auto get_type_scope_declarations(which w = all) const + -> std::vector<declaration_node const*> + { + // Convert the gather_ results to const* + auto tmp = gather_type_scope_declarations(w); + return std::vector<declaration_node const*>(tmp.begin(), tmp.end()); + } + + + auto add_type_member( std::unique_ptr<statement_node>&& statement ) + -> bool + { + if ( + !is_type() + || !initializer + || !initializer->is_compound() + || !statement->is_declaration() + ) + { + return false; + } + + // Tell this declaration statement that we are its new parent + // and check to ensure that it doesn't already have a parent + // (that shouldn't happen because we should only get here for a + // generated statement that hasn't been added elsewhere yet) + auto decl = statement->get_if<declaration_node>(); + assert( + decl + && !decl->parent_declaration + ); + decl->parent_declaration = this; + + // And actually adopt it into our list of statements + auto compound_stmt = initializer->get_if<compound_statement_node>(); + assert (compound_stmt); + compound_stmt->statements.push_back(std::move(statement)); + return true; + } + + + auto add_function_initializer( std::unique_ptr<statement_node>&& statement ) + -> bool + { + if ( + !is_function() + || initializer + ) + { + return false; + } + + // Adopt it as our initializer statement + initializer = std::move( statement ); + return true; + } + + + auto get_decl_if_type_scope_object_name_before_a_base_type( std::string_view s ) const + -> declaration_node const* + { + declaration_node const* ret = {}; + + // If it's 'this' then it can't be an object name + if (s == "this") { + return {}; + } + + // Navigate to the nearest enclosing type + auto decl = this; + while ( + !decl->is_type() + && decl->parent_declaration + ) + { + decl = decl->parent_declaration; + } + + if (!decl->is_type()) { + return {}; + } + + // Look for a name match and if so remember the type, + // and look for a base type after that match + auto objects = decl->get_type_scope_declarations(); + auto found_name = false; + auto found_later_base_type = false; + + for (auto& o : objects) { + if (o->is_alias()) { + continue; + } + if (o->has_name(s)) { + found_name = true; + ret = o; + } + if (o->has_name("this")) { + if (found_name) { + found_later_base_type = true; + break; + } + } + } + + // If we didn't find a later base type, discard any name match + if (!found_later_base_type) { + ret = {}; + } + + return ret; + } + + + auto get_initializer_statements() const + -> std::vector<statement_node*> + { + if (!initializer) { + return {}; + } + + auto ret = std::vector<statement_node*>{}; + // For non-compound initializers, we want just that statement + if (!initializer->is_compound()) + { + ret.push_back(initializer.get()); + } + + // Else for compound initializers, we want the compound_statement's statements + else + { + auto compound_stmt = initializer->get_if<compound_statement_node>(); + assert (compound_stmt); + for (auto& o : compound_stmt->statements) { + ret.push_back(o.get()); + } + } + + return ret; + } + + auto is_function_with_this() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_function_with_this(); + } + // else + return false; + } + + auto is_virtual_function() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_virtual_function(); + } + // else + return false; + } + + auto is_type_final() const + -> bool + { + if (auto t = std::get_if<a_type>(&type)) { + return (*t)->is_final(); + } + // else + return false; + } + + auto make_type_final() + -> bool + { + if (auto t = std::get_if<a_type>(&type)) { + (*t)->make_final(); + return true; + } + // else + return false; + } + + auto make_function_virtual() + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->make_function_virtual(); + } + // else + return false; + } + + auto is_defaultable_function() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_defaultable(); + } + // else + return false; + } + + auto is_constructor() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_constructor(); + } + // else + return false; + } + + auto is_default_constructor() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_default_constructor(); + } + // else + return false; + } + + auto is_move() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_move(); + } + // else + return false; + } + + auto is_swap() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_swap(); + } + // else + return false; + } + + auto is_constructor_with_that() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_constructor_with_that(); + } + // else + return false; + } + + auto is_constructor_with_in_that() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_constructor_with_in_that(); + } + // else + return false; + } + + auto is_constructor_with_move_that() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_constructor_with_move_that(); + } + // else + return false; + } + + auto is_comparison() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_comparison(); + } + // else + return false; + } + + auto is_increment_or_decrement() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_increment_or_decrement(); + } + // else + return false; + } + + auto is_compound_assignment() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_compound_assignment(); + } + // else + return false; + } + + auto is_assignment() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_assignment(); + } + // else + return false; + } + + auto is_assignment_with_that() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_assignment_with_that(); + } + // else + return false; + } + + auto is_assignment_with_in_that() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_assignment_with_in_that(); + } + // else + return false; + } + + auto is_assignment_with_move_that() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_assignment_with_move_that(); + } + // else + return false; + } + + struct declared_value_set_funcs { + declaration_node const* out_this_in_that = {}; + declaration_node const* out_this_move_that = {}; + declaration_node const* inout_this_in_that = {}; + declaration_node const* inout_this_move_that = {}; + std::vector<std::string> assignments_from = {}; + }; + + auto find_declared_value_set_functions() const + -> declared_value_set_funcs + { + if (!initializer) { + return {}; + } + + auto compound_stmt = initializer->get_if<compound_statement_node>(); + assert (compound_stmt); + + auto ret = declared_value_set_funcs{}; + for (auto& o : compound_stmt->statements) + { + auto decl = o->get_if<declaration_node>(); + if (decl) + { + if (decl->is_constructor_with_in_that()) { + ret.out_this_in_that = decl; + } + if (decl->is_constructor_with_move_that()) { + ret.out_this_move_that = decl; + } + if (decl->is_assignment_with_in_that()) { + ret.inout_this_in_that = decl; + } + if (decl->is_assignment_with_move_that()) { + ret.inout_this_move_that = decl; + } + if (decl->is_assignment() && !decl->is_assignment_with_that()) { + ret.assignments_from.emplace_back( decl->nth_parameter_type_name(2) ); + } + } + } + + return ret; + } + + auto find_parent_declared_value_set_functions() const + -> declared_value_set_funcs + { + if (parent_is_type()) { + return parent_declaration->find_declared_value_set_functions(); + } + // else + return {}; + } + + + auto is_destructor() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->is_destructor(); + } + // else + return false; + } + + auto has_declared_return_type() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->has_declared_return_type(); + } + // else + return false; + } + + auto has_deduced_return_type() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->has_deduced_return_type(); + } + // else + return false; + } + + auto get_function_parameters() + -> std::vector<parameter_declaration_node const*> + { + if (!is_function()) { + return {}; + } + // else + auto ret = std::vector<parameter_declaration_node const*>{}; + for (auto& param : std::get<a_function>(type)->parameters->parameters) { + ret.push_back( param.get() ); + } + return ret; + } + + auto unnamed_return_type_to_string() const + -> std::string + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->unnamed_return_type_to_string(); + } + // else + return {}; + } + + auto has_bool_return_type() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->has_bool_return_type(); + } + // else + return false; + } + + auto has_non_void_return_type() const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->has_non_void_return_type(); + } + // else + return false; + } + + auto has_parameter_with_name_and_pass( + std::string_view s, + passing_style pass + ) const + -> bool + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->has_parameter_with_name_and_pass(s, pass); + } + // else + return false; + } + + auto first_parameter_name() const + -> std::string + { + if (auto func = std::get_if<a_function>(&type)) { + return (*func)->first_parameter_name(); + } + // else + return ""; + } + + auto is_binary_comparison_function() const + -> bool + { + return + is_function() + && ( + has_name("operator==") + || has_name("operator!=") + || has_name("operator<") + || has_name("operator<=") + || has_name("operator>") + || has_name("operator>=") + ); + } + + auto is_const() const + -> bool + { + return + type.index() == an_object + && !std::get<an_object>(type)->pc_qualifiers.empty() + && *std::get<an_object>(type)->pc_qualifiers.front() == "const" + ; + } + + auto has_wildcard_type() const + -> bool + { + return + type.index() == an_object + && std::get<an_object>(type)->is_wildcard() + ; + } + + auto get_object_type() const + -> type_id_node const* + { + if (type.index() == an_object) { + return std::get<an_object>(type).get(); + } + // Else + return {}; + } + + // Internals + // + auto position() const + -> source_position + { + if (identifier) { + return identifier->position(); + } + return pos; + } + + auto visit(auto& v, int depth) + -> void + { + v.start(*this, depth); + + v.start(declaration_identifier_tag{}, depth); + if (identifier) { + identifier->visit(v, depth+1); + } + v.end(declaration_identifier_tag{}, depth); + + try_visit<a_function >(type, v, depth+1); + try_visit<an_object >(type, v, depth+1); + try_visit<a_type >(type, v, depth+1); + try_visit<a_namespace>(type, v, depth+1); + try_visit<an_alias >(type, v, depth+1); + + for (auto& m : metafunctions) { + assert(m); + m->visit(v, depth+1); + } + + if (initializer) { + initializer->visit(v, depth+1); + } + + v.end(*this, depth); + } +}; + + +compound_statement_node::compound_statement_node(source_position o) + : open_brace{o} +{ } + + +statement_node::statement_node(compound_statement_node* compound_parent_) + : compound_parent{ compound_parent_ } +{ } + + +function_type_node::function_type_node(declaration_node* decl) + : my_decl{decl} +{ } + + +auto parameter_declaration_node::has_name() const + -> bool +{ + return declaration->has_name(); +} + + +auto parameter_declaration_node::name() const + -> token const* +{ + return declaration->name(); +} + + +auto parameter_declaration_node::has_name(std::string_view s) const + -> bool +{ + return declaration->has_name(s); +} + + +auto function_type_node::first_parameter_name() const + -> std::string +{ + if (std::ssize(parameters->parameters) > 0) + { + assert (parameters->parameters[0]->declaration->name()); + return parameters->parameters[0]->declaration->name()->to_string(); + } + // Else + return ""; +} + +auto function_type_node::nth_parameter_type_name(int n) const + -> std::string +{ + if (std::ssize(parameters->parameters) >= n) + { + return parameters->parameters[n-1]->declaration->get_object_type()->to_string(); + } + // Else + return ""; +} + + +auto function_type_node::has_postconditions() const + -> bool +{ + return + std::find_if( + contracts.begin(), + contracts.end(), + [](auto const& e){ return *e->kind == "post"; } + ) != contracts.end(); +} + +auto function_type_node::is_function_with_this() const + -> bool +{ + if ( + (*parameters).ssize() > 0 + && (*parameters)[0]->has_name("this") + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_virtual_function() const + -> bool +{ + if ( + (*parameters).ssize() > 0 + && (*parameters)[0]->has_name("this") + && (*parameters)[0]->is_virtual() + ) + { + return true; + } + return false; +} + + +auto function_type_node::make_function_virtual() + -> bool +{ + if (is_function_with_this()) { + (*parameters)[0]->make_virtual(); + return true; + } + return false; +} + + +auto function_type_node::is_defaultable() const + -> bool +{ + if ( + my_decl->has_name("operator==") + || my_decl->has_name("operator<=>") + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_constructor() const + -> bool +{ + if ( + (*parameters).ssize() > 0 + && (*parameters)[0]->has_name("this") + && (*parameters)[0]->direction() == passing_style::out + ) + { + assert(my_decl->has_name("operator=")); + return true; + } + return false; +} + + +auto function_type_node::is_default_constructor() const + -> bool +{ + if ( + is_constructor() + && (*parameters).ssize() == 1 + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_move() const + -> bool +{ + if ( + (is_constructor() || is_assignment()) + && (*parameters).ssize() == 2 + && (*parameters)[1]->has_name("that") + && (*parameters)[1]->direction() == passing_style::move + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_swap() const + -> bool +{ + assert (my_decl); + if ( + my_decl->has_name("swap") + && (*parameters).ssize() == 2 + && (*parameters)[1]->has_name("that") + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_constructor_with_that() const + -> bool +{ + if ( + is_constructor() + && (*parameters).ssize() == 2 + && (*parameters)[1]->has_name("that") + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_assignment_with_that() const + -> bool +{ + if ( + is_assignment() + && (*parameters).ssize() == 2 + && (*parameters)[1]->has_name("that") + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_constructor_with_in_that() const + -> bool +{ + if ( + is_constructor() + && (*parameters).ssize() == 2 + && (*parameters)[1]->has_name("that") + && (*parameters)[1]->direction() == passing_style::in + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_constructor_with_move_that() const + -> bool +{ + if ( + is_constructor() + && (*parameters).ssize() == 2 + && (*parameters)[1]->has_name("that") + && (*parameters)[1]->direction() == passing_style::move + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_comparison() const + -> bool +{ + if ( + ( + my_decl->has_name("operator==") + || my_decl->has_name("operator!=") + || my_decl->has_name("operator<") + || my_decl->has_name("operator<=") + || my_decl->has_name("operator>") + || my_decl->has_name("operator>=") + || my_decl->has_name("operator<=>") + ) + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_increment_or_decrement() const + -> bool +{ + if ( + my_decl->has_name("operator++") + || my_decl->has_name("operator--") + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_compound_assignment() const + -> bool +{ + if ( + ( + my_decl->has_name("operator+=") + || my_decl->has_name("operator-=") + || my_decl->has_name("operator*=") + || my_decl->has_name("operator/=") + || my_decl->has_name("operator%=") + || my_decl->has_name("operator&=") + || my_decl->has_name("operator|=") + || my_decl->has_name("operator^=") + || my_decl->has_name("operator<<=") + || my_decl->has_name("operator>>=") + ) + && (*parameters).ssize() > 1 + && (*parameters)[0]->has_name("this") + && (*parameters)[0]->direction() == passing_style::inout + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_assignment() const + -> bool +{ + if ( + my_decl->has_name("operator=") + && (*parameters).ssize() > 1 + && (*parameters)[0]->has_name("this") + && (*parameters)[0]->direction() == passing_style::inout + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_assignment_with_in_that() const + -> bool +{ + if ( + is_assignment() + && (*parameters).ssize() == 2 + && (*parameters)[1]->has_name("that") + && (*parameters)[1]->direction() == passing_style::in + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_assignment_with_move_that() const + -> bool +{ + if ( + is_assignment() + && (*parameters).ssize() == 2 + && (*parameters)[1]->has_name("that") + && (*parameters)[1]->direction() == passing_style::move + ) + { + return true; + } + return false; +} + + +auto function_type_node::is_destructor() const + -> bool +{ + if ( + my_decl->has_name("operator=") + && (*parameters).ssize() == 1 + && (*parameters)[0]->has_name("this") + && (*parameters)[0]->direction() == passing_style::move + ) + { + return true; + } + return false; +} + + +auto primary_expression_node::template_arguments() const + -> std::vector<template_argument> const& +{ + if (expr.index() == id_expression) { + return std::get<id_expression>(expr)->template_arguments(); + } + // else + return no_template_args; +} + + +auto primary_expression_node::get_token() const + -> token const* +{ + if (expr.index() == identifier) { + return std::get<identifier>(expr); + } + else if (expr.index() == id_expression) { + return std::get<id_expression>(expr)->get_token(); + } + else if (expr.index() == literal) { + return std::get<literal>(expr)->get_token(); + } + // else (because we're deliberately ignoring the other + // options which are more than a single token) + return {}; +} + + +auto primary_expression_node::to_string() const + -> std::string +{ + switch (expr.index()) + { + break;case empty: + return {}; + + break;case identifier: { + auto const& s = std::get<identifier>(expr); + assert (s); + return s->to_string(); + } + + break;case id_expression: { + auto const& s = std::get<id_expression>(expr); + assert (s); + return s->to_string(); + } + + break;case literal: { + auto const& i = std::get<literal>(expr); + assert (i); + return i->to_string(); + } + + break;default: + return "(*ERROR*) temporary alpha limitation: type metafunctions cannot stringize expressions that involve nested expression-lists, declarations, or inspect expressions"; + } +} + + +auto primary_expression_node::position() const + -> source_position +{ + switch (expr.index()) + { + break;case empty: + return { 0, 0 }; + + break;case identifier: { + auto const& s = std::get<identifier>(expr); + assert (s); + return s->position(); + } + + break;case expression_list: { + auto const& s = std::get<expression_list>(expr); + assert (s); + return s->position(); + } + + break;case id_expression: { + auto const& s = std::get<id_expression>(expr); + assert (s); + return s->position(); + } + + break;case declaration: { + auto const& s = std::get<declaration>(expr); + assert (s); + return s->position(); + } + + break;case inspect: { + auto const& i = std::get<inspect>(expr); + assert (i); + return i->position(); + } + + break;case literal: { + auto const& i = std::get<literal>(expr); + assert (i); + return i->position(); + } + + break;default: + assert (!"illegal primary_expression_node state"); + return { 0, 0 }; + } +} + + +auto primary_expression_node::visit(auto& v, int depth) + -> void +{ + v.start(*this, depth); + try_visit<identifier >(expr, v, depth); + try_visit<expression_list>(expr, v, depth); + try_visit<id_expression >(expr, v, depth); + try_visit<declaration >(expr, v, depth); + try_visit<inspect >(expr, v, depth); + try_visit<literal >(expr, v, depth); + v.end(*this, depth); +} + + +struct next_expression_tag { }; +struct loop_body_tag { token const* identifier; }; + +auto iteration_statement_node::visit(auto& v, int depth) + -> void +{ + v.start(*this, depth); + if (label) { + label->visit(v, depth+1); + } + if (identifier) { + identifier->visit(v, depth+1); + } + if (statements) { + statements->visit(v, depth+1); + } + if (next_expression) { + v.start(next_expression_tag{}, depth); + next_expression->visit(v, depth+1); + v.end(next_expression_tag{}, depth); + } + if (condition) { + assert(!range && !body); + condition->visit(v, depth+1); + } + else { + assert(range && parameter && body); + range->visit(v, depth+1); + v.start(loop_body_tag{identifier}, depth); + parameter->visit(v, depth+1); + body->visit(v, depth+1); + } + v.end(*this, depth); +} + + +auto statement_node::position() const + -> source_position +{ + switch (statement.index()) + { + break;case expression: { + auto const& s = std::get<expression>(statement); + assert (s); + return s->position(); + } + + break;case compound: { + auto const& s = std::get<compound>(statement); + assert (s); + return s->position(); + } + + break;case selection: { + auto const& s = std::get<selection>(statement); + assert (s); + return s->position(); + } + + break;case declaration: { + auto const& s = std::get<declaration>(statement); + assert (s); + return s->position(); + } + + break;case return_: { + auto const& s = std::get<return_>(statement); + assert (s); + return s->position(); + } + + break;case iteration: { + auto const& s = std::get<iteration>(statement); + assert (s); + return s->position(); + } + + break;case using_: { + auto const& s = std::get<using_>(statement); + assert (s); + return s->position(); + } + + break;case contract: { + auto const& s = std::get<contract>(statement); + assert (s); + return s->position(); + } + + break;case inspect: { + auto const& s = std::get<inspect>(statement); + assert (s); + return s->position(); + } + + break;case jump: { + auto const& s = std::get<jump>(statement); + assert (s); + return s->position(); + } + + break;default: + assert (!"illegal statement_node state"); + return { 0, 0 }; + } +} + + +auto parameter_declaration_node::position() const + -> source_position +{ + assert (declaration); + return pos; +} + + +auto parameter_declaration_node::visit(auto& v, int depth) + -> void +{ + v.start(*this, depth); + assert(declaration); + declaration->visit(v, depth + 1); + v.end(*this, depth); +} + + +struct translation_unit_node +{ + std::vector< std::unique_ptr<declaration_node> > declarations; + + auto position() const -> source_position + { + if (std::ssize(declarations) > 0) { + return declarations.front()->position(); + } + return {}; + } + + auto visit(auto& v, int depth) -> void + { + v.start(*this, depth); + for (auto const& x : declarations) { + assert(x); + x->visit(v, depth + 1); + } + v.end(*this, depth); + } +}; + + +//----------------------------------------------------------------------- +// +// pretty_print_visualize: pretty-prints Cpp2 ASTs +// +//----------------------------------------------------------------------- +// +auto pretty_print_visualize(token const& n, int indent) + -> std::string; +auto pretty_print_visualize(primary_expression_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(literal_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(prefix_expression_node const& n, int indent) + -> std::string; +template< + String Name, + typename Term +> +auto pretty_print_visualize(binary_expression_node<Name,Term> const& n, int indent) + -> std::string; +auto pretty_print_visualize(expression_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(expression_list_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(expression_statement_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(postfix_expression_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(unqualified_id_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(qualified_id_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(type_id_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(is_as_expression_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(id_expression_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(compound_statement_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(selection_statement_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(iteration_statement_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(return_statement_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(alternative_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(inspect_expression_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(contract_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(jump_statement_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(using_statement_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(statement_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(parameter_declaration_node const& n, int indent, bool is_template_param = false) + -> std::string; +auto pretty_print_visualize(parameter_declaration_list_node const& n, int indent, bool is_template_param_list = false) + -> std::string; +auto pretty_print_visualize(function_type_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(type_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(namespace_node const& n, int indent) + -> std::string; +auto pretty_print_visualize(declaration_node const& n, int indent, bool include_metafunctions_list = false) + -> std::string; + + + +//----------------------------------------------------------------------- +// pre: Get an indentation prefix +// +inline static int indent_spaces = 2; +inline static std::string indent_str = std::string( 1024, ' ' ); // "1K should be enough for everyone" + +auto pre(int indent) + -> std::string_view +{ + assert (indent >= 0); + return { + indent_str.c_str(), + as<size_t>( std::min( indent*indent_spaces, _as<int>(std::ssize(indent_str))) ) + }; +} + + +//----------------------------------------------------------------------- +// try_pretty_print_visualize +// +// Helper to emit whatever is in a variant where each +// alternative is a smart pointer +// +template <int I> +auto try_pretty_print_visualize( + auto& v, + auto&&... more +) + -> std::string +{ + if (v.index() == I) { + auto const& alt = std::get<I>(v); + assert (alt); + return pretty_print_visualize (*alt, CPP2_FORWARD(more)...); + } + return ""; +} + + +auto pretty_print_visualize(token const& t, int) + -> std::string +{ + return t.to_string(); +} + + +auto pretty_print_visualize(primary_expression_node const& n, int indent) + -> std::string +{ + auto ret = std::string{}; + + ret += try_pretty_print_visualize<primary_expression_node::identifier >(n.expr, indent); + ret += try_pretty_print_visualize<primary_expression_node::expression_list>(n.expr, indent); + ret += try_pretty_print_visualize<primary_expression_node::id_expression >(n.expr, indent); + ret += try_pretty_print_visualize<primary_expression_node::declaration >(n.expr, indent); + ret += try_pretty_print_visualize<primary_expression_node::inspect >(n.expr, indent); + ret += try_pretty_print_visualize<primary_expression_node::literal >(n.expr, indent); + + return ret; +} + + +auto pretty_print_visualize(literal_node const& n, int) + -> std::string +{ + // TODO: This is an initial visualizer implementation, and still + // skips a few rarer things (such as raw string literals) + + assert(n.literal); + + auto ret = n.literal->to_string(); + + if (n.user_defined_suffix) { + ret += n.user_defined_suffix->as_string_view(); + } + + return ret; +} + + +auto pretty_print_visualize(prefix_expression_node const& n, int indent) + -> std::string +{ + assert(n.expr); + + auto ret = std::string{}; + + for (auto& op : n.ops) { + assert(op); + ret += op->as_string_view(); + } + + ret += pretty_print_visualize(*n.expr, indent); + + return ret; +} + + +template< + String Name, + typename Term +> +auto pretty_print_visualize(binary_expression_node<Name,Term> const& n, int indent) + -> std::string +{ + assert(n.expr); + + auto ret = pretty_print_visualize(*n.expr, indent); + for (auto& term : n.terms) { + assert(term.op && term.expr); + ret += " " + term.op->to_string() + + " " + pretty_print_visualize(*term.expr, indent); + } + return ret; +} + + +auto pretty_print_visualize(expression_node const& n, int indent) + -> std::string +{ + assert(n.expr); + return pretty_print_visualize(*n.expr, indent); +} + + +auto pretty_print_visualize(expression_list_node const& n, int indent) + -> std::string +{ + assert(n.open_paren && n.close_paren); + + auto ret = n.open_paren->to_string(); + + for (auto i = 0; auto& expr : n.expressions) { + assert(expr.expr); + if ( + expr.pass == passing_style::out + || expr.pass == passing_style::move + || expr.pass == passing_style::forward + ) + { + ret += to_string_view(expr.pass) + std::string{" "}; + } + ret += pretty_print_visualize(*expr.expr, indent); + if (++i < std::ssize(n.expressions)) { + ret += ", "; + } + } + + ret += n.close_paren->as_string_view(); + + return ret; +} + + +auto pretty_print_visualize(expression_statement_node const& n, int indent) + -> std::string +{ + assert(n.expr); + + auto ret = pretty_print_visualize(*n.expr, indent); + + if (n.has_semicolon && ret.back() != ';') { + ret += ";"; + } + + return ret; +} + + +auto pretty_print_visualize(postfix_expression_node const& n, int indent) + -> std::string +{ + assert(n.expr); + + auto ret = pretty_print_visualize(*n.expr, indent); + + for (auto& op : n.ops) + { + assert(op.op); + if (op.expr_list) { + assert (op.op_close); + ret += pretty_print_visualize(*op.expr_list, indent); + } + else { + ret += op.op->as_string_view(); + if (op.id_expr) { + ret += pretty_print_visualize(*op.id_expr, indent); + } + } + } + + return ret; +} + + +auto pretty_print_visualize(unqualified_id_node const& n, int indent) + -> std::string +{ + assert(n.identifier); + + auto ret = n.identifier->to_string(); + + if (n.open_angle != source_position{}) + { + ret += "<"; + for (bool first = true; auto& arg : n.template_args) + { + if (!first) { + ret += ", "; + } + first = false; + ret += try_pretty_print_visualize<template_argument::expression>(arg.arg, indent); + ret += try_pretty_print_visualize<template_argument::type_id >(arg.arg, indent); + } + ret += ">"; + } + + return ret; +} + + +auto pretty_print_visualize(qualified_id_node const& n, int indent) + -> std::string +{ + auto ret = std::string{}; + + for (auto& id : n.ids) { + if (id.scope_op) { ret += id.scope_op->as_string_view(); } + assert (id.id); + ret += pretty_print_visualize(*id.id, indent); + } + + return ret; +} + + +auto pretty_print_visualize(type_id_node const& n, int indent) + -> std::string +{ + auto ret = std::string{}; + + for (auto& qual : n.pc_qualifiers) { + assert(qual); + ret += qual->as_string_view(); + ret += " "; + } + + if (n.id.index() == type_id_node::empty) { ret += "_"; } + ret += try_pretty_print_visualize<type_id_node::qualified >(n.id, indent); + ret += try_pretty_print_visualize<type_id_node::unqualified>(n.id, indent); + ret += try_pretty_print_visualize<type_id_node::keyword >(n.id, indent); + + return ret; +} + + +auto pretty_print_visualize(is_as_expression_node const& n, int indent) + -> std::string +{ + assert (n.expr); + + auto ret = pretty_print_visualize(*n.expr, indent); + + for (auto& op : n.ops) { + if (op.op) { ret += " " + op.op->to_string() + " "; } + if (op.type) { ret += pretty_print_visualize(*op.type, indent); } + if (op.expr) { ret += pretty_print_visualize(*op.expr, indent); } + } + + return ret; +} + + +auto pretty_print_visualize(id_expression_node const& n, int indent) + -> std::string +{ + auto ret = std::string{}; + + ret += try_pretty_print_visualize<id_expression_node::qualified >(n.id, indent); + ret += try_pretty_print_visualize<id_expression_node::unqualified>(n.id, indent); + + return ret; +} + + +auto pretty_print_visualize(compound_statement_node const& n, int indent) + -> std::string +{ + auto ret = std::string{"\n"} + pre(indent) + "{"; + + for (auto& stmt : n.statements) { + assert (stmt); + ret += pretty_print_visualize(*stmt, indent+1); + } + + ret += std::string{"\n"} + pre(indent) + "}"; + + return ret; +} + + +auto pretty_print_visualize(selection_statement_node const& n, int indent) + -> std::string +{ + assert (n.identifier && n.expression && n.true_branch && n.false_branch); + + auto ret = std::string{}; + + ret += std::string{"\n"} + pre(indent) + n.identifier->as_string_view() + " "; + + if (n.is_constexpr) { + ret += "constexpr "; + } + + ret += pretty_print_visualize(*n.expression, indent) + + pretty_print_visualize(*n.true_branch, indent); + + if (n.has_source_false_branch) { + ret += std::string{"\n"} + pre(indent) + "else " + + pretty_print_visualize(*n.false_branch, indent); + } + + return ret; +} + + +auto pretty_print_visualize(iteration_statement_node const& n, int indent) + -> std::string +{ + // First compute the common parts + + auto next_expr = std::string{}; + if (n.next_expression) { + next_expr += std::string{"\n"} + pre(indent) + "next " + pretty_print_visualize(*n.next_expression, indent); + } + + auto stmts = std::string{}; + if (n.statements) { + stmts += pretty_print_visualize(*n.statements, indent+1); + } + + // Then slot them in where appropriate + + auto ret = std::string{}; + assert (n.identifier); + + ret += std::string{"\n"} + pre(indent); + if (n.label) { + ret += n.label->to_string() + + ": "; + } + + if (*n.identifier == "while") { + assert (n.condition); + ret += "while " + + pretty_print_visualize(*n.condition, indent) + next_expr + stmts; + } + else if (*n.identifier == "do") { + assert (n.condition); + ret += "do " + + stmts + + next_expr + + "\n" + pre(indent) + "while " + + pretty_print_visualize(*n.condition, indent); + if (ret.back() != ';') { + ret += ";"; + } + } + else { + assert (n.range && n.parameter && n.body); + ret += "for " + + pretty_print_visualize(*n.range, indent) + + next_expr + + "\n" + pre(indent) + "do (" + pretty_print_visualize(*n.parameter, indent + 1) + ")" + + pretty_print_visualize(*n.body, indent+1); + } + + return ret; +} + + +auto pretty_print_visualize(return_statement_node const& n, int indent) + -> std::string +{ + auto ret = std::string{"\n"} + pre(indent) + "return"; + + if (n.expression) { + ret += " " + pretty_print_visualize(*n.expression, indent); + } + + if (ret.back() != ';') { + ret += ";"; + } + + return ret; +} + + +auto pretty_print_visualize(alternative_node const& n, int indent) + -> std::string +{ + auto ret = std::string{}; + assert (n.is_as_keyword); + ret += std::string{"\n"} + pre(indent); + if (n.name) { + ret += pretty_print_visualize(*n.name, indent) + ": "; + } + ret += n.is_as_keyword->as_string_view(); + if (n.type_id) { + ret += " " + pretty_print_visualize(*n.type_id, indent); + } + if (n.value) { + ret += " " + pretty_print_visualize(*n.value, indent); + } + ret += " = " + pretty_print_visualize(*n.statement, indent+1); + return ret; +} + + +auto pretty_print_visualize(inspect_expression_node const& n, int indent) + -> std::string +{ + assert (n.expression); + + auto ret = std::string{"inspect"}; + + if (n.is_constexpr) { + ret += " constexpr"; + } + + ret += " " + pretty_print_visualize(*n.expression, indent); + + if (n.result_type) { + ret += " -> " + pretty_print_visualize(*n.result_type, indent); + } + + ret += " {"; + + for (auto& alt : n.alternatives) { + assert(alt); + ret += pretty_print_visualize(*alt, indent+1); + } + + ret += std::string{"\n"} + pre(indent) + "}"; + + return ret; +} + + +auto pretty_print_visualize(contract_node const& n, int indent) + -> std::string +{ + assert (n.kind && n.condition); + + auto ret = std::string{"\n"} + pre(indent) + n.kind->as_string_view(); + + if (n.group) { + ret += "<" + pretty_print_visualize(*n.group, indent); + for (auto const& flag : n.flags) { + ret += "," + pretty_print_visualize(*flag, indent); + } + ret += ">"; + } + + ret += "( " + pretty_print_visualize(*n.condition, indent); + + if (n.message) { + ret += ", " + pretty_print_visualize(*n.message, indent); + } + + ret += " )"; + + if (*n.kind == "assert" && ret.back() != ';') { + ret += ";"; + } + + return ret; +} + + +auto pretty_print_visualize(jump_statement_node const& n, int indent) + -> std::string +{ + assert (n.keyword); + + auto ret = std::string{"\n"} + pre(indent) + n.keyword->as_string_view(); + + if (n.label) { + ret += " " + n.label->to_string(); + } + + if (ret.back() != ';') { + ret += ";"; + } + + return ret; +} + + +auto pretty_print_visualize(using_statement_node const& n, int indent) + -> std::string +{ + assert (n.keyword); + + auto ret = std::string{"\n"} + pre(indent) + n.keyword->as_string_view() + " "; + + if (n.for_namespace) { + ret += "namespace "; + } + + ret += pretty_print_visualize(*n.id, indent); + if (ret.back() != ';') { + ret += ";"; + } + + return ret; +} + + +auto pretty_print_visualize(statement_node const& n, int indent) + -> std::string +{ + auto ret = std::string{}; + + if (n.is_expression()) + { + if (n.compound_parent) { + ret += std::string{"\n"} + pre(indent); + } + auto& expr = std::get<statement_node::expression>(n.statement); + assert (expr); + ret += pretty_print_visualize(*expr, indent); + } + else + { + if (n.parameters) { + ret += std::string{"\n"} + pre(indent) + pretty_print_visualize(*n.parameters, indent); + } + + ret += try_pretty_print_visualize<statement_node::compound >(n.statement, indent); + ret += try_pretty_print_visualize<statement_node::selection >(n.statement, indent); + ret += try_pretty_print_visualize<statement_node::declaration>(n.statement, indent); + ret += try_pretty_print_visualize<statement_node::return_ >(n.statement, indent); + ret += try_pretty_print_visualize<statement_node::iteration >(n.statement, indent); + ret += try_pretty_print_visualize<statement_node::using_ >(n.statement, indent); + ret += try_pretty_print_visualize<statement_node::contract >(n.statement, indent); + ret += try_pretty_print_visualize<statement_node::inspect >(n.statement, indent); + ret += try_pretty_print_visualize<statement_node::jump >(n.statement, indent); + } + + return ret; +} + + +auto pretty_print_visualize(parameter_declaration_node const& n, int indent, bool is_template_param_list /* = false */ ) + -> std::string +{ + assert (n.declaration); + + auto ret = std::string{}; + + if (!is_template_param_list) { + switch (n.mod) { + break;case parameter_declaration_node::modifier::implicit : ret += "implicit "; + break;case parameter_declaration_node::modifier::virtual_ : ret += "virtual "; + break;case parameter_declaration_node::modifier::override_: ret += "override "; + break;case parameter_declaration_node::modifier::final_ : ret += "final "; + break;default: ; // none + } + + ret += to_string_view(n.pass); + ret += " "; + } + + ret += pretty_print_visualize(*n.declaration, indent); + + return ret; +} + + +auto pretty_print_visualize(parameter_declaration_list_node const& n, int indent, bool is_template_param_list /* = false */) + -> std::string +{ + assert(n.open_paren && n.close_paren); + + auto ret = n.open_paren->to_string(); + + auto space = std::string{}; + if (std::ssize(n.parameters) > 1) { + space += std::string{"\n"} + pre(indent+1); + } + + for (auto i = 0; auto& param : n.parameters) { + ret += space + pretty_print_visualize(*param, indent+1, is_template_param_list); + if (++i < std::ssize(n.parameters)) { + ret += ", "; + } + } + + if (std::ssize(n.parameters) > 1) { + ret += std::string{"\n"} + pre(indent); + } + ret += n.close_paren->to_string(); + + return ret; +} + + +auto pretty_print_visualize(function_type_node const& n, int indent) + -> std::string +{ + assert (n.parameters); + + auto ret = pretty_print_visualize(*n.parameters, indent); + + if (n.throws) { + ret += " throws"; + } + + if (n.has_non_void_return_type()) { + ret += " -> "; + ret += try_pretty_print_visualize<function_type_node::list>(n.returns, indent+1); + if (n.returns.index() == function_type_node::id) { + auto& single = std::get<function_type_node::id>(n.returns); + ret += to_string_view(single.pass) + + std::string{" "} + pretty_print_visualize(*single.type, indent+1); + } + } + + for (auto& contract: n.contracts) { + assert(contract); + ret += pretty_print_visualize(*contract, indent+1); + } + + return ret; +} + + +auto pretty_print_visualize(type_node const& n) + -> std::string +{ + assert (n.type); + + auto ret = std::string{}; + + if (n.final) { + ret += "final "; + } + + ret += "type"; + + return ret; +} + + +auto pretty_print_visualize(namespace_node const&) + -> std::string +{ + return "namespace"; +} + + +auto pretty_print_visualize(declaration_node const& n, int indent, bool include_metafunctions_list /* = false */ ) + -> std::string +{ + indent_spaces = 4; + + // First compute the common parts + + auto metafunctions = std::string{}; + if (include_metafunctions_list) { + for (auto& meta : n.metafunctions) { + metafunctions += " @" + pretty_print_visualize(*meta, indent); + } + } + + auto template_params = std::string{}; + if (n.template_parameters) { + template_params += " " + pretty_print_visualize(*n.template_parameters, indent + 1, true); + } + + auto requires_clause = std::string{}; + if (n.requires_clause_expression) { + requires_clause += " requires (" + pretty_print_visualize(*n.requires_clause_expression, indent) + ")"; + } + + auto initializer = std::string{}; + if (n.initializer) { + auto adjusted_indent = indent; + if (!n.name()) { + ++adjusted_indent; + } + initializer = " ="; + if (n.is_function() && n.is_constexpr) { + initializer += "="; + } + initializer += " " + pretty_print_visualize(*n.initializer, adjusted_indent); + if (initializer.ends_with(";;")) { + initializer.pop_back(); + } + } + else if (!n.is_parameter) { + initializer = ";"; + } + + // Then slot them in where appropriate + + auto ret = std::string{""}; + + // Add an extra newline for spacing, unless this declaration + // is within a function body or is the first member of a type + if ( + !n.parent_is_function() + && !n.parent_is_object() + && !n.is_parameter + ) + { + static declaration_node const* last_parent_type = {}; + if (n.parent_is_type()) { + if (last_parent_type != n.get_parent()) { + last_parent_type = n.get_parent(); + } + else { + ret += "\n"; + } + } + else { + ret += "\n"; + } + } + if (!n.is_parameter && n.name()) { + ret += std::string{"\n"} + pre(indent); + } + + switch (n.access) { + break;case accessibility::public_ : ret += "public "; + break;case accessibility::protected_ : ret += "protected "; + break;case accessibility::private_ : ret += "private "; + break;default: ; // default accessibility + } + + if (n.identifier) { + ret += pretty_print_visualize(*n.identifier, indent); + } + + if (n.is_parameter && (n.has_name("this") || n.has_name("that"))) { + return ret; + } + + if (n.is_variadic) { + ret += "..."; + } + + ret += ":"; + + if (n.is_function()) { + auto& func = std::get<declaration_node::a_function>(n.type); + assert(func); + ret += metafunctions + + template_params + + pretty_print_visualize(*func, indent) + + requires_clause + + initializer; + } + else if (n.is_object()) { + auto& type_id = std::get<declaration_node::an_object>(n.type); + assert(type_id); + ret += metafunctions + + template_params; + if (!n.has_wildcard_type()) { + ret += " " + pretty_print_visualize(*type_id, indent); + } + ret += requires_clause + + initializer; + } + else if (n.is_type()) { + auto& t = std::get<declaration_node::a_type>(n.type); + assert(t); + ret += metafunctions + + template_params + + " " + pretty_print_visualize(*t) + + initializer; + } + else if (n.is_namespace()) { + auto& t = std::get<declaration_node::a_type>(n.type); + assert(t); + ret += "namespace = " + + initializer; + } + else if (n.is_alias()) { + auto& a = std::get<declaration_node::an_alias>(n.type); + assert(a); + + auto object_type_id = std::string{}; + if (a->type_id) { + object_type_id += " " + pretty_print_visualize(*a->type_id, indent); + } + + ret += template_params; + if (a->is_type_alias()) { + auto& t = std::get<alias_node::a_type>(a->initializer); + ret += " type" + + requires_clause + + " == " + + pretty_print_visualize(*t, indent); + if (ret.back() != ';') { + ret += ";"; + } + } + else if (a->is_namespace_alias()) { + auto& id = std::get<alias_node::a_namespace>(a->initializer); + assert(id); + ret += " namespace == " + + pretty_print_visualize(*id, indent); + if (ret.back() != ';') { + ret += ";"; + } + } + else if (a->is_object_alias()) { + auto& expr = std::get<alias_node::an_object>(a->initializer); + assert(expr); + ret += object_type_id + + requires_clause + + " == " + + pretty_print_visualize(*expr, indent); + if (ret.back() != ';') { + ret += ";"; + } + } + } + + return ret; +} + + +auto pretty_print_visualize(translation_unit_node const& n) + -> std::string +{ + auto ret = std::string{}; + + for (auto& decl : n.declarations) { + assert(decl); + ret += pretty_print_visualize(*decl, 0); + } + + return ret; +} + + +//----------------------------------------------------------------------- +// +// parser: parses a section of Cpp2 code +// +//----------------------------------------------------------------------- +// +class parser +{ + std::vector<error_entry>& errors; + + std::unique_ptr<translation_unit_node> parse_tree = {}; + + // Keep a stack of current capture groups (contracts/decls still being parsed) + std::vector<capture_group*> current_capture_groups = {}; + + struct capture_groups_stack_guard + { + parser* pars; + + capture_groups_stack_guard(parser* p, capture_group* cg) + : pars{ p } + { + assert(p); + assert(cg); + pars->current_capture_groups.push_back(cg); + } + + ~capture_groups_stack_guard() + { + pars->current_capture_groups.pop_back(); + } + }; + + // Keep a stack of currently active declarations (still being parsed) + std::vector<declaration_node*> current_declarations = { nullptr }; + + struct current_declarations_stack_guard + { + parser* pars; + + current_declarations_stack_guard(parser* p, declaration_node* decl) + : pars{ p } + { + assert(p); + assert(decl); + pars->current_declarations.push_back(decl); + } + + ~current_declarations_stack_guard() + { + pars->current_declarations.pop_back(); + } + }; + + std::vector<token> const* tokens = {}; + std::deque<token>* generated_tokens = {}; + int pos = 0; + std::string parse_kind = {}; + + // Keep track of the function bodies' locations - used to emit comments + // in the right pass (decide whether it's a comment that belongs with + // the declaration or is part of the definition) + struct function_body_extent { + lineno_t first; + lineno_t last; + auto operator<=>(function_body_extent const&) const = default; + auto operator<=>(int i) const { return first <=> i; } + + function_body_extent( lineno_t f, lineno_t l ): first{f}, last{l} { } + }; + mutable std::vector<function_body_extent> function_body_extents; + mutable bool is_function_body_extents_sorted = false; + +public: + auto is_within_function_body(source_position p) const + { + // Short circuit the empty case, so that the rest of the function + // can unconditionally decrement any non-.begin() iterator once + if (function_body_extents.empty()) { + return false; + } + + // Ensure we are sorted + if (!is_function_body_extents_sorted) { + std::sort( + function_body_extents.begin(), + function_body_extents.end() + ); + is_function_body_extents_sorted = true; + } + + // Find the first entry that is beyond pos, and back up one to + // the last that could be a match; this also ensures iter is + // dereferenceable, not .end() + auto iter = std::lower_bound( + function_body_extents.begin(), + function_body_extents.end(), + p.lineno+1 + ); + if (iter != function_body_extents.begin()) { + --iter; + } + + // Now go backwards through the preceding entries until + // one includes pos or we move before pos + while ( + iter->first <= p.lineno + ) + { + if ( + iter->first <= p.lineno + && p.lineno <= iter->last + ) + { + return true; + } + if (iter == function_body_extents.begin()) { + break; + } + --iter; + } + return false; + } + + +public: + //----------------------------------------------------------------------- + // Constructors - the copy constructor constructs a new instance with + // the same errors reference but otherwise a clean slate + // + // errors error list + // + parser( std::vector<error_entry>& errors_ ) + : errors{ errors_ } + , parse_tree{std::make_unique<translation_unit_node>()} + { } + + parser( parser const& that ) + : errors{ that.errors } + , parse_tree{std::make_unique<translation_unit_node>()} + { } + + + //----------------------------------------------------------------------- + // parse + // + // tokens input tokens for this section of Cpp2 source code + // generated_tokens a shared place to store generated tokens + // + // Each call parses this section's worth of tokens and adds the + // result to the stored parse tree. Call this repeatedly for the Cpp2 + // sections in a TU to build the whole TU's parse tree + // + auto parse( + std::vector<token> const& tokens_, + std::deque<token>& generated_tokens_ + ) + -> bool + { + parse_kind = "source file"; + + // Set per-parse state for the duration of this call + tokens = &tokens_; + generated_tokens = &generated_tokens_; + + // Generate parse tree for this section as if a standalone TU + pos = 0; + auto tu = translation_unit(); + + // Then add it to the complete parse tree + parse_tree->declarations.insert( + parse_tree->declarations.end(), + std::make_move_iterator(tu->declarations.begin()), + std::make_move_iterator(tu->declarations.end()) + ); + if (!done()) { + error("unexpected text at end of Cpp2 code section", true, {}, true); + return false; + } + return true; + } + + + //----------------------------------------------------------------------- + // parse_one_statement + // + // tokens input tokens for this section of Cpp2 source code + // generated_tokens a shared place to store generated tokens + // + // Each call parses one statement and returns its parse tree. + // + auto parse_one_declaration( + std::vector<token> const& tokens_, + std::deque<token>& generated_tokens_ + ) + -> std::unique_ptr<statement_node> + { + parse_kind = "source string during code generation"; + + // Set per-parse state for the duration of this call + tokens = &tokens_; + generated_tokens = &generated_tokens_; + + try { + // Parse one declaration - we succeed if the parse succeeded, + // and there were no new errors, and all tokens were consumed + auto errors_size = std::ssize(errors); + pos = 0; + if (auto d = statement(); + d + && std::ssize(errors) == errors_size + && done() + ) + { + return d; + } + } + catch(std::runtime_error& e) { + error(e.what(), true, {}, true); + } + + return {}; + } + + + //----------------------------------------------------------------------- + // Get a set of pointers to just the declarations in the given token map section + // + auto get_parse_tree_declarations_in_range(std::vector<token> const& token_range) const + -> std::vector< declaration_node const* > + { + assert (parse_tree); + assert (!token_range.empty()); + auto first_line = token_range.front().position().lineno; + auto last_line = token_range.back().position().lineno; + + auto ret = std::vector< declaration_node const* >{}; + for (auto& decl : parse_tree->declarations) + { + assert(decl); + + // The grammar and the tokens are in lineno order, so we don't + // need to look further once we pass the last lineno + if (decl->position().lineno > last_line) { + break; + } + if (decl->position().lineno >= first_line) { + ret.push_back( decl.get() ); + } + } + + return ret; + } + + + //----------------------------------------------------------------------- + // visit + // + auto visit(auto& v) -> void + { + parse_tree->visit(v, 0); + } + +private: + //----------------------------------------------------------------------- + // Error reporting: Fed into the supplied this->errors object + // + // msg message to be printed + // + // include_curr_token in this file (during parsing), we normally want + // to show the current token as the unexpected text + // we encountered, but some sema rules are applied + // early during parsing and for those it doesn't + // make sense to show the next token (e.g., when + // we detect and reject a "std::move" qualified-id, + // it's not relevant to add "at LeftParen: (" + // just because ( happens to be the next token) + // + auto error( + char const* msg, + bool include_curr_token = true, + source_position err_pos = {}, + bool fallback = false + ) const + -> void + { + auto m = std::string{msg}; + auto i = done() ? -1 : 0; + assert (peek(i)); + if (include_curr_token) { + m += std::string(" (at '") + peek(i)->to_string() + "')"; + } + if ( + err_pos == source_position{} + ) { + err_pos = peek(i)->position(); + } + errors.emplace_back( err_pos, m, false, fallback ); + } + + auto error( + std::string const& msg, + bool include_curr_token = true, + source_position err_pos = {}, + bool fallback = false + ) const + -> void + { + error( msg.c_str(), include_curr_token, err_pos, fallback ); + } + + bool has_error() { + return !errors.empty(); + } + + + //----------------------------------------------------------------------- + // Token navigation: Only these functions should access this->token_ + // + auto curr() const + -> token const& + { + if (done()) { + throw std::runtime_error("unexpected end of " + parse_kind); + } + + return (*tokens)[pos]; + } + + auto peek(int num) const + -> token const* + { + assert (tokens); + if ( + pos + num >= 0 + && pos + num < std::ssize(*tokens) + ) + { + return &(*tokens)[pos + num]; + } + return {}; + } + + auto done() const + -> bool + { + assert (tokens); + assert (pos <= std::ssize(*tokens)); + return pos == std::ssize(*tokens); + } + + auto next(int num = 1) + -> void + { + assert (tokens); + pos = std::min( pos+num, _as<int>(std::ssize(*tokens)) ); + } + + + //----------------------------------------------------------------------- + // Parsers for unary expressions + // + + //G primary-expression: + //G inspect-expression + //G id-expression + //G literal + //G '(' expression-list ')' + //GT '{' expression-list '}' + //G unnamed-declaration + //G + auto primary_expression() + -> std::unique_ptr<primary_expression_node> + { + auto n = std::make_unique<primary_expression_node>(); + + if (auto inspect = inspect_expression(true)) + { + n->expr = std::move(inspect); + return n; + } + + if (auto id = id_expression()) { + n->expr = std::move(id); + return n; + } + + if (auto lit = literal()) { + n->expr = std::move(lit); + return n; + } + + if (curr().type() == lexeme::LeftParen + // If in the future (not now) we decide to allow braced-expressions + // || curr().type() == lexeme::LeftBrace + ) + { + bool inside_initializer = ( + peek(-1) && peek(-1)->type() == lexeme::Assignment + ); + auto open_paren = &curr(); + auto close = close_paren_type(open_paren->type()); + auto close_text = [&] () -> std::string { if (close == lexeme::RightParen) { return ")"; } return "}"; }(); + next(); + auto expr_list = expression_list(open_paren, inside_initializer); + if (!expr_list) { + error("unexpected text - ( is not followed by an expression-list"); + next(); + return {}; + } + if (curr().type() != close_paren_type(open_paren->type())) { + error("unexpected text - expression-list is not terminated by " + close_text); + next(); + return {}; + } + expr_list->close_paren = &curr(); + next(); + if ( + curr().type() != lexeme::Semicolon + && curr().type() != lexeme::RightParen + && curr().type() != lexeme::RightBracket + && curr().type() != lexeme::Greater + && curr().type() != lexeme::Comma + ) { + expr_list->inside_initializer = false; + } + n->expression_list_is_fold_expression = expr_list->is_fold_expression(); + n->expr = std::move(expr_list); + return n; + } + + if (auto decl = unnamed_declaration(curr().position(), false, true)) // captures are allowed + { + assert ( + !decl->has_name() + && "ICE: declaration should have been unnamed" + ); + + if (auto obj = std::get_if<declaration_node::an_object>(&decl->type)) { + if ((*obj)->is_wildcard()) { + error("an unnamed object at expression scope currently cannot have a deduced type (the reason to create an unnamed object is typically to create a temporary of a named type)"); + next(); + return {}; + } + } + else if (auto func = std::get_if<declaration_node::a_function>(&decl->type)) { + if ((*func)->returns.index() == function_type_node::list) { + error("an unnamed function at expression scope currently cannot return multiple values"); + next(); + return {}; + } + if ( // check if a single-expression function is followed by an extra second semicolon + decl->initializer && decl->initializer->is_expression() + && !done() && curr().type() == lexeme::Semicolon + ) { + error("a single-expression function should end with a single semicolon"); + } + if (!(*func)->contracts.empty()) { + error("an unnamed function at expression scope currently cannot have contracts"); + next(); + return {}; + } + } + else { + error("(temporary alpha limitation) an unnamed declaration at expression scope must be a function or an object"); + next(); + return {}; + } + + if ( + peek(-1) && peek(-1)->type() != lexeme::RightBrace // it is not a braced function expression + && curr().type() != lexeme::LeftParen // not imediatelly called + && curr().type() != lexeme::RightParen // not as a last argument to function + && curr().type() != lexeme::Comma // not as first or in-the-middle, function argument + && curr().type() != lexeme::Greater // not as the last argument to template + && curr().type() != lexeme::RightBracket // not as the last index argument + && curr() != "is" // not as the argument to is + && curr() != "as" // not as the argument to as + && curr() != "do" // not as `for`'s `next`. + ) { + // this is a fix for a short function syntax that should have double semicolon used + // (check comment in expression_statement(bool semicolon_required)) + // We simulate double semicolon by moving back to single semicolon. + next(-1); + } + + n->expr = std::move(decl); + return n; + } + + return {}; + } + + + //G postfix-expression: + //G primary-expression + //G postfix-expression postfix-operator [Note: without whitespace before the operator] + //G postfix-expression '[' expression-list? ']' + //G postfix-expression '(' expression-list? ')' + //G postfix-expression '.' id-expression + //G + auto postfix_expression() + -> std::unique_ptr<postfix_expression_node> + { + auto n = std::make_unique<postfix_expression_node>(); + n->expr = primary_expression(); + if (!(n->expr)) { + return {}; + } + + while ( + !done() + && ( + (is_postfix_operator(curr().type()) + // Postfix operators must be lexically adjacent + && curr().position().lineno == peek(-1)->position().lineno + && curr().position().colno == peek(-1)->position().colno + peek(-1)->length() + ) + || curr().type() == lexeme::LeftBracket + || curr().type() == lexeme::LeftParen + || curr().type() == lexeme::Dot + ) + ) + { + // these can't be unary operators if followed by a (, identifier, or literal + if ( + ( + curr().type() == lexeme::Multiply + || curr().type() == lexeme::Ampersand + || curr().type() == lexeme::Tilde + ) + && peek(1) + && ( + peek(1)->type() == lexeme::LeftParen + || peek(1)->type() == lexeme::Identifier + || is_literal(peek(1)->type()) + ) + ) + { + auto op = curr().to_string(); + auto msg = "postfix unary " + op; + if (curr().type() == lexeme::Multiply ) { msg += " (dereference)" ; } + else if (curr().type() == lexeme::Ampersand) { msg += " (address-of)" ; } + else if (curr().type() == lexeme::Tilde ) { msg += " (unary bit-complement)" ; } + msg += " cannot be immediately followed by a (, identifier, or literal - add whitespace before " + + op + " here if you meant binary " + op; + if (curr().type() == lexeme::Multiply ) { msg += " (multiplication)" ; } + else if (curr().type() == lexeme::Ampersand) { msg += " (bitwise and)" ; } + else if (curr().type() == lexeme::Tilde ) { msg += " (binary bit-complement)"; } + + error(msg, false); + break; + } + + if (curr().type() == lexeme::Dollar) { + // cap_grp must not already be set, or this is a multi-$ postfix-expression + if (n->cap_grp) { + error("$ (capture) can appear at most once in a single postfix-expression"); + return {}; + } + if (current_capture_groups.empty()) { + error("$ (capture) cannot appear here - it must appear in an anonymous expression function, a postcondition, or an interpolated string literal"); + return {}; + } + n->cap_grp = current_capture_groups.back(); + n->cap_grp->add(n.get()); + } + + // Remember current position, in case we need to backtrack + auto term_pos = pos; + + auto term = postfix_expression_node::term{&curr()}; + next(); + + if (term.op->type() == lexeme::LeftBracket) + { + term.expr_list = expression_list(term.op); + if (!term.expr_list) + { + error("[ is not followed by a valid expression list"); + return {}; + } + if (curr().type() != lexeme::RightBracket) + { + error("unexpected text - [ is not properly matched by ]", true, {}, true); + return {}; + } + term.expr_list->close_paren = &curr(); + term.op_close = &curr(); + next(); + } + else if (term.op->type() == lexeme::LeftParen) + { + // Next should be an expression-list followed by a ')' + // If not, then this wasn't a call expression so backtrack to + // the '(' which will be part of the next grammar production + + term.expr_list = expression_list(term.op); + if ( + term.expr_list + && curr().type() == lexeme::RightParen + ) + { + term.expr_list->close_paren = &curr(); + term.op_close = &curr(); + next(); + } + else + { + pos = term_pos; // backtrack + break; + } + } + else if (term.op->type() == lexeme::Dot) + { + term.id_expr = id_expression(); + if (!term.id_expr) { + error("'.' must be followed by a valid member name"); + return {}; + } + } + + n->ops.push_back( std::move(term) ); + } + + if (auto tok = n->expr->get_token(); + tok + && *tok == "this" + && curr().type() == lexeme::Arrow + ) + { + auto next_word = std::string{}; + if (peek(1)) { + next_word = peek(1)->to_string(); + } + error("'this' is not a pointer - write 'this." + next_word + "' instead of 'this->" + next_word + "'"); + return {}; + } + + for (auto& e : expression_node::current_expressions) { + e->num_subexpressions += std::ssize(n->ops); + } + + return n; + } + + + //G prefix-expression: + //G postfix-expression + //G prefix-operator prefix-expression + //GTODO await-expression + //GTODO 'sizeof' '(' type-id ')' + //GTODO 'sizeof' '...' ( identifier ')' + //GTODO 'alignof' '(' type-id ')' + //GTODO throws-expression + //G + auto prefix_expression() + -> std::unique_ptr<prefix_expression_node> + { + auto n = std::make_unique<prefix_expression_node>(); + for ( ; + is_prefix_operator(curr()); + next() + ) + { + n->ops.push_back(&curr()); + } + if ((n->expr = postfix_expression())) { + return n; + } + switch (curr().type()) + { + break; case lexeme::PlusPlus: + error("prefix '++var' is not valid Cpp2; use postfix 'var++' instead", false); + break; case lexeme::MinusMinus: + error("prefix '--var' is not valid Cpp2; use postfix 'var--' instead", false); + break; case lexeme::Multiply: + error("prefix '*ptr' dereference is not valid Cpp2; use postfix 'ptr*' instead", false); + break; case lexeme::Ampersand: + error("prefix '&var' address-of is not valid Cpp2; use postfix 'var&' instead", false); + break; case lexeme::Tilde: + error("prefix '~var' is not valid Cpp2; use postfix 'var~' instead", false); + break; default: ; + } + return {}; + } + + + //----------------------------------------------------------------------- + // Parsers for binary expressions + // + + // The general /*binary*/-expression: + // /*term*/-expression { { /* operators at this precedence level */ } /*term*/-expression }* + // + template< + typename Binary, + typename ValidateOp, + typename TermFunc + > + auto binary_expression( + ValidateOp validate_op, + TermFunc term + ) + -> std::unique_ptr<Binary> + { + auto n = std::make_unique<Binary>(); + if ( (n->expr = term()) ) + { + while (!done()) + { + typename Binary::term t{}; + + // Remember current position, because we may need to backtrack if this next + // t.op might be valid but isn't followed by a valid term and so isn't for us + auto term_pos = pos; + + // Most of these predicates only look at the current token and return + // true/false == whether this is a valid operator for this production + if constexpr( requires{ bool{ validate_op(curr()) }; } ) { + if (!validate_op(curr())) { + break; + } + t.op = &curr(); + next(); + } + + // But for shift-expression we may synthesize >> from > > + // which will return a token* == a valid operator for this production + // (possibly a synthesized new token) or nullptr otherwise + else if constexpr( requires{ validate_op(curr(), *peek(1)); } ) { + if ( + peek(1) == nullptr + || (t.op = validate_op(curr(), *peek(1))) == nullptr + ) + { + break; + } + // If we didn't consume the next token, we consumed the next two + if (t.op != &curr()) { + next(); + } + next(); + } + + // And it shouldn't be anything else + else { + assert (!"ICE: validate_op should take one token and return bool, or two tokens and return token const* "); + } + + // At this point we may have a valid t.op, so try to parse the next term... + // If it's not a valid term, then this t.op wasn't for us, pop it and return + // what we found (e.g., with "requires expression = {...}" the = is a grammar + // element and not an operator, it isn't and can't be part of the expression) + if ( !(t.expr = term()) ) { + pos = term_pos; // backtrack + return n; + } + + // We got a term, so this op + term was for us + n->terms.push_back( std::move(t) ); + } + return n; + } + return {}; + } + + //G multiplicative-expression: + //G is-as-expression + //G multiplicative-expression '*' is-as-expression + //G multiplicative-expression '/' is-as-expression + //G multiplicative-expression '%' is-as-expression + //G + auto multiplicative_expression() + -> auto + { + return binary_expression<multiplicative_expression_node> ( + [](token const& t){ return t.type() == lexeme::Multiply || t.type() == lexeme::Slash || t.type() == lexeme::Modulo; }, + [this]{ return is_as_expression(); } + ); + } + + //G additive-expression: + //G multiplicative-expression + //G additive-expression '+' multiplicative-expression + //G additive-expression '-' multiplicative-expression + //G + auto additive_expression() + -> auto + { + return binary_expression<additive_expression_node> ( + [](token const& t){ return t.type() == lexeme::Plus || t.type() == lexeme::Minus; }, + [this]{ return multiplicative_expression(); } + ); + } + + //G shift-expression: + //G additive-expression + //G shift-expression '<<' additive-expression + //G shift-expression '>>' additive-expression + //G + auto shift_expression(bool allow_angle_operators = true) + -> auto + { + if (allow_angle_operators) { + return binary_expression<shift_expression_node> ( + [this](token const& t, token const& next) -> token const* { + if (t.type() == lexeme::LeftShift) { + return &t; + } + if ( + t.type() == lexeme::Greater + && next.type() == lexeme::Greater + && t.position() == source_position{ next.position().lineno, next.position().colno-1 } + ) + { + generated_tokens->emplace_back( ">>", t.position(), lexeme::RightShift); + return &generated_tokens->back(); + } + return nullptr; + }, + [this]{ return additive_expression(); } + ); + } + else { + return binary_expression<shift_expression_node> ( + [](token const&, token const&) -> token const* { return nullptr; }, + [this]{ return additive_expression(); } + ); + } + } + + //G compare-expression: + //G shift-expression + //G compare-expression '<=>' shift-expression + //G + auto compare_expression(bool allow_angle_operators = true) + -> auto + { + return binary_expression<compare_expression_node> ( + [](token const& t){ return t.type() == lexeme::Spaceship; }, + [=,this]{ return shift_expression(allow_angle_operators); } + ); + } + + //G relational-expression: + //G compare-expression + //G relational-expression '<' compare-expression + //G relational-expression '>' compare-expression + //G relational-expression '<=' compare-expression + //G relational-expression '>=' compare-expression + //G + auto relational_expression(bool allow_angle_operators = true) + -> auto + { + if (allow_angle_operators) { + return binary_expression<relational_expression_node> ( + [](token const& t, token const& next) -> token const* { + if ( + t.type() == lexeme::Less + || t.type() == lexeme::LessEq + || (t.type() == lexeme::Greater && next.type() != lexeme::GreaterEq) + || t.type() == lexeme::GreaterEq + ) { + return &t; + } + return nullptr; + }, + [=,this]{ return compare_expression(allow_angle_operators); } + ); + } + else { + return binary_expression<relational_expression_node> ( + [](token const&, token const&) -> token const* { return nullptr; }, + [=,this]{ return compare_expression(allow_angle_operators); } + ); + } + } + + //G equality-expression: + //G relational-expression + //G equality-expression '==' relational-expression + //G equality-expression '!=' relational-expression + //G + auto equality_expression(bool allow_angle_operators = true, bool allow_equality = true) + -> auto + { + if (allow_equality) { + return binary_expression<equality_expression_node> ( + [](token const& t){ return t.type() == lexeme::EqualComparison || t.type() == lexeme::NotEqualComparison; }, + [=,this]{ return relational_expression(allow_angle_operators); } + ); + } + else { + return binary_expression<equality_expression_node> ( + [](token const& t){ return t.type() == lexeme::NotEqualComparison; }, + [=,this]{ return relational_expression(allow_angle_operators); } + ); + } + } + + //G bit-and-expression: + //G equality-expression + //G bit-and-expression '&' equality-expression + //G + auto bit_and_expression(bool allow_angle_operators = true, bool allow_equality = true) + -> auto + { + return binary_expression<bit_and_expression_node> ( + [](token const& t){ return t.type() == lexeme::Ampersand; }, + [=,this]{ return equality_expression(allow_angle_operators, allow_equality); } + ); + } + + //G bit-xor-expression: + //G bit-and-expression + //G bit-xor-expression '^' bit-and-expression + //G + auto bit_xor_expression(bool allow_angle_operators = true, bool allow_equality = true) + -> auto + { + return binary_expression<bit_xor_expression_node> ( + [](token const& t){ return t.type() == lexeme::Caret; }, + [=,this]{ return bit_and_expression(allow_angle_operators, allow_equality); } + ); + } + + //G bit-or-expression: + //G bit-xor-expression + //G bit-or-expression '|' bit-xor-expression + //G + auto bit_or_expression(bool allow_angle_operators = true, bool allow_equality = true) + -> auto + { + return binary_expression<bit_or_expression_node> ( + [](token const& t){ return t.type() == lexeme::Pipe; }, + [=,this]{ return bit_xor_expression(allow_angle_operators, allow_equality); } + ); + } + + //G logical-and-expression: + //G bit-or-expression + //G logical-and-expression '&&' bit-or-expression + //G + auto logical_and_expression(bool allow_angle_operators = true, bool allow_equality = true) + -> auto + { + return binary_expression<logical_and_expression_node> ( + [](token const& t){ return t.type() == lexeme::LogicalAnd; }, + [=,this]{ return bit_or_expression(allow_angle_operators, allow_equality); } + ); + } + + // constant-expression: // don't need intermediate production, just use: + // conditional-expression: // don't need intermediate production, just use: + //G logical-or-expression: + //G logical-and-expression + //G logical-or-expression '||' logical-and-expression + //G + auto logical_or_expression(bool allow_angle_operators = true, bool allow_equality = true) + -> auto + { + return binary_expression<logical_or_expression_node> ( + [](token const& t){ return t.type() == lexeme::LogicalOr; }, + [=,this]{ return logical_and_expression(allow_angle_operators, allow_equality); } + ); + } + + //G assignment-expression: + //G logical-or-expression + //G assignment-expression assignment-operator logical-or-expression + //G + auto assignment_expression( + bool allow_angle_operators = true + ) + -> std::unique_ptr<assignment_expression_node> + { + auto ret = std::unique_ptr<assignment_expression_node>{}; + + if (allow_angle_operators) + { + ret = binary_expression<assignment_expression_node> ( + [this](token const& t, token const& next) -> token const* { + if (is_assignment_operator(t.type())) { + return &t; + } + if ( + t.type() == lexeme::Greater + && next.type() == lexeme::GreaterEq + && t.position() == source_position{ next.position().lineno, next.position().colno-1 } + ) + { + generated_tokens->emplace_back( ">>=", t.position(), lexeme::RightShiftEq); + return &generated_tokens->back(); + } + return nullptr; + }, + [=,this]{ + return logical_or_expression(allow_angle_operators); + } + ); + } + else + { + ret = binary_expression<assignment_expression_node> ( + [](token const&, token const&) -> token const* { return nullptr; }, + [=,this]{ + return logical_or_expression(allow_angle_operators); + } + ); + } + + if (ret && ret->terms_size() > 1) { + error("assignment cannot be chained - instead of 'c = b = a;', write 'b = a; c = b;'", false); + return {}; + } + + return ret; + } + + //G expression: // eliminated 'condition:' - just use 'expression:' + //G assignment-expression + //GTODO try expression + //G + auto expression( + bool allow_angle_operators = true, + bool check_arrow = true + ) + -> std::unique_ptr<expression_node> + { + auto n = std::make_unique<expression_node>(); + + { + expression_node::current_expressions.push_back(n.get()); + auto guard = finally([&]{ expression_node::current_expressions.pop_back(); }); + + if (!(n->expr = assignment_expression(allow_angle_operators))) { + return {}; + } + + if ( + check_arrow + && !done() + && curr().type() == lexeme::Arrow + ) + { + error("'->' is not Cpp2 deference syntax - write '*.' instead"); + return {}; + } + } + + for (auto& e : expression_node::current_expressions) { + ++e->num_subexpressions; + } + return n; + } + + //G expression-list: + //G parameter-direction? expression + //G expression-list ',' parameter-direction? expression + //G + auto expression_list( + token const* open_paren, + bool inside_initializer = false + ) + -> std::unique_ptr<expression_list_node> + { + auto pass = passing_style::in; + auto n = std::make_unique<expression_list_node>(); + n->open_paren = open_paren; + n->inside_initializer = inside_initializer; + + if (auto dir = to_passing_style(curr()); + ( + dir == passing_style::out + || dir == passing_style::move + || dir == passing_style::forward + ) + && peek(1) + && peek(1)->type() == lexeme::Identifier + ) + { + pass = dir; + next(); + } + auto x = expression(); + + // If this is an empty expression_list, we're done + if (!x) { + return n; + } + + // Otherwise remember the first expression + n->expressions.push_back( { pass, std::move(x) } ); + // and see if there are more... + while (curr().type() == lexeme::Comma) { + next(); + pass = passing_style::in; + if (auto dir = to_passing_style(curr()); + dir == passing_style::out + || dir == passing_style::move + || dir == passing_style::forward + ) + { + pass = dir; + next(); + } + auto expr = expression(); + if (!expr) { + error("invalid text in expression list", true, {}, true); + return {}; + } + n->expressions.push_back( { pass, std::move(expr) } ); + } + return n; + } + + + //G type-id: + //G type-qualifier-seq? qualified-id + //G type-qualifier-seq? unqualified-id + //G + //G type-qualifier-seq: + //G type-qualifier + //G type-qualifier-seq type-qualifier + //G + //G type-qualifier: + //G 'const' + //G '*' + //G + auto type_id() + -> std::unique_ptr<type_id_node> + { + auto n = std::make_unique<type_id_node>(); + + while ( + (curr().type() == lexeme::Keyword && curr() == "const") + || curr().type() == lexeme::Multiply + ) + { + if ( + curr() == "const" + && !n->pc_qualifiers.empty() + && *n->pc_qualifiers.back() == "const" + ) + { + error("consecutive 'const' not allowed"); + return {}; + } + n->pc_qualifiers.push_back( &curr() ); + next(); + } + + if (auto id = qualified_id()) { + n->pos = id->position(); + n->id = std::move(id); + assert (n->id.index() == type_id_node::qualified); + } + else if (auto id = unqualified_id()) { + n->pos = id->position(); + n->id = std::move(id); + assert (n->id.index() == type_id_node::unqualified); + } + else { + if (!n->pc_qualifiers.empty()) { + error("'*'/'const' type qualifiers must be followed by a type name or '_' wildcard"); + } + return {}; + } + if (curr().type() == lexeme::Multiply) { + error("'T*' is not a valid Cpp2 type; use '*T' for a pointer instead", false); + return {}; + } + + return n; + } + + + //G is-as-expression: + //G prefix-expression + //G is-as-expression is-type-constraint + //G is-as-expression is-value-constraint + //G is-as-expression as-type-cast + //GTODO type-id is-type-constraint + //G + //G is-type-constraint + //G 'is' type-id + //G + //G is-value-constraint + //G 'is' expression + //G + //G as-type-cast + //G 'as' type-id + //G + auto is_as_expression() + -> std::unique_ptr<is_as_expression_node> + { + auto n = std::make_unique<is_as_expression_node>(); + n->expr = prefix_expression(); + if (!(n->expr)) { + return {}; + } + + auto is_found = false; + auto as_found = false; + + while ( + !done() + && (curr() == "is" || curr() == "as") + ) + { + if (curr() == "is") { + if (is_found) { + error("repeated 'is' are not allowed"); + return {}; + } + is_found = true; + } + else { + as_found = true; + } + + if (is_found && as_found) { + error("mixed 'is' and 'as' are not allowed"); + return {}; + } + + auto term = is_as_expression_node::term{}; + term.op = &curr(); + next(); + + if ((term.type = type_id()) != nullptr) { + ; + } + else if ((term.expr = expression()) != nullptr) { + ; + } + + if ( + *term.op == "as" + && term.expr + ) + { + error("'as' must be followed by a type-id, not an expression", false); + return {}; + } + if ( + !term.type + && !term.expr + ) + { + if (*term.op == "is") { + error( "'is' must be followed by a type-id or an expression", false); + } + else { + error( "'as' must be followed by a type-id", false); + } + return {}; + } + + n->ops.push_back( std::move(term) ); + } + + return n; + } + + + //G unqualified-id: + //G identifier + //G keyword + //G template-id + //GTODO operator-function-id + //G ... + //G + //G template-id: + //G identifier '<' template-argument-list? '>' + //G + //G template-argument-list: + //G template-argument-list ',' template-argument + //G + //G template-argument: + //G # note: < > << >> are not allowed in expressions until new ( is opened + //G 'const' type-id + //G expression + //G type-id + //G + auto unqualified_id() + -> std::unique_ptr<unqualified_id_node> + { + // Handle the identifier + if ( + curr().type() != lexeme::Identifier + && curr().type() != lexeme::Keyword + && curr().type() != lexeme::Cpp2FixedType + && curr().type() != lexeme::Ellipsis + ) + { + return {}; + } + + auto n = std::make_unique<unqualified_id_node>(); + + n->identifier = &curr(); + auto one_past_identifier_end_pos = curr().position(); + one_past_identifier_end_pos.colno += curr().length(); + next(); + + // Handle the template-argument-list if there is one + if ( + curr().type() == lexeme::Less + && curr().position() == one_past_identifier_end_pos + ) + { + // Remember current position, in case this < is isn't a template argument list + auto start_pos = pos; + + n->open_angle = curr().position(); + next(); + + auto term = template_argument{}; + + do { + // If it doesn't start with * or const (which can only be a type id), + // try parsing it as an expression + if (auto e = [&]{ + if ( + curr().type() == lexeme::Multiply // '*' + || curr() == "const" // 'const' + ) + { + return decltype(expression()){}; + } + return expression(false); // false == disallow unparenthesized relational comparisons in template args + }() + ) + { + term.arg = std::move(e); + } + + // Else try parsing it as a type id + else if (auto i = type_id()) { + term.arg = std::move(i); + } + + // Else if we already got at least one template-argument, this is a + // ',' followed by something that isn't a valid template-arg + else if (std::ssize(n->template_args) > 0) { + error( "expected a template argument after ','", false); + return {}; + } + + // Else this is an empty '<>' list which is okay + else { + break; + } + + n->template_args.push_back( std::move(term) ); + } + // Use the lambda trick to jam in a "next" clause + while ( + curr().type() == lexeme::Comma + && [&]{term.comma = curr().position(); next(); return true;}() + ); + // When this is rewritten in Cpp2, it will be: + // while curr().type() == lexeme::Comma + // next term.comma = curr().position(); + + if (curr().type() != lexeme::Greater) { + // Aha, this wasn't a template argument list after all, + // so back out just that part and return the identifier + n->open_angle = source_position{}; + n->template_args.clear(); + pos = start_pos; + return n; + } + n->close_angle = curr().position(); + next(); + } + + else { + if (*n->identifier == "new") { + error( "use 'new<" + curr().to_string() + ">', not 'new " + curr().to_string() + "'", false); + return {}; + } + if (*n->identifier == "co_await" || *n->identifier == "co_yield") { + error( "(temporary alpha limitation) coroutines are not yet supported in Cpp2", false); + return {}; + } + } + + return n; + } + + + //G qualified-id: + //G nested-name-specifier unqualified-id + //G member-name-specifier unqualified-id + //G + //G nested-name-specifier: + //G '::' + //G unqualified-id '::' + //G + //G member-name-specifier: + //G unqualified-id '.' + //G + auto qualified_id() + -> std::unique_ptr<qualified_id_node> + { + auto n = std::make_unique<qualified_id_node>(); + + auto term = qualified_id_node::term{nullptr}; + + // Handle initial :: if present, else the first scope_op will be null + if (curr().type() == lexeme::Scope) { + term.scope_op = &curr(); + next(); + } + + // Remember current position, because we need to look ahead to the next :: + auto start_pos = pos; + + // If we don't get a first id, or if we didn't have a leading :: and + // the next thing isn't :: or ., back out and report unsuccessful + term.id = unqualified_id(); + if ( + !term.id + || (!term.scope_op && curr().type() != lexeme::Scope) + ) + { + pos = start_pos; // backtrack + return {}; + } + + // Reject "std" :: "move" / "forward" + assert (term.id->identifier); + auto first_uid_was_std = (*term.id->identifier == "std"); + auto first_time_through_loop = true; + + n->ids.push_back( std::move(term) ); + + while (curr().type() == lexeme::Scope) + { + auto term = qualified_id_node::term{ &curr() }; + next(); + term.id = unqualified_id(); + if (!term.id) { + error("invalid text in qualified name", true, {}, true); + return {}; + } + assert (term.id->identifier); + if ( + first_time_through_loop + && first_uid_was_std + && term.scope_op->type() == lexeme::Scope + ) + { + if (*term.id->identifier == "move") { + error("std::move is not needed in Cpp2 - use 'move' parameters/arguments instead", false); + return {}; + } + else if (*term.id->identifier == "forward") { + error("std::forward is not needed in Cpp2 - use 'forward' parameters/arguments instead", false); + return {}; + } + first_time_through_loop = false; + } + n->ids.push_back( std::move(term) ); + } + + return n; + } + + + //G id-expression: + //G qualified-id + //G unqualified-id + //G + auto id_expression() + -> std::unique_ptr<id_expression_node> + { + auto n = std::make_unique<id_expression_node>(); + if (auto id = qualified_id()) { + n->pos = id->position(); + n->id = std::move(id); + assert (n->id.index() == id_expression_node::qualified); + return n; + } + if (auto id = unqualified_id()) { + n->pos = id->position(); + n->id = std::move(id); + assert (n->id.index() == id_expression_node::unqualified); + return n; + } + return {}; + } + + //G literal: + //G integer-literal ud-suffix? + //G character-literal ud-suffix? + //G floating-point-literal ud-suffix? + //G string-literal ud-suffix? + //G boolean-literal ud-suffix? + //G pointer-literal ud-suffix? + //G user-defined-literal ud-suffix? + //G + auto literal() + -> std::unique_ptr<literal_node> + { + if (is_literal(curr().type())) { + auto n = std::make_unique<literal_node>(); + n->literal = &curr(); + next(); + if (curr().type() == lexeme::UserDefinedLiteralSuffix) { + n->user_defined_suffix = &curr(); + next(); + } + return n; + } + return {}; + } + + //G expression-statement: + //G expression ';' + //G expression + //G + auto expression_statement( + bool semicolon_required + ) + -> std::unique_ptr<expression_statement_node> + { + auto n = std::make_unique<expression_statement_node>(); + + expression_statement_node::current_expression_statements.push_back(n.get()); + auto guard = finally([&]{ expression_statement_node::current_expression_statements.pop_back(); }); + + if (!(n->expr = expression(true, true))) { + return {}; + } + + if ( + semicolon_required + && (done() || curr().type() != lexeme::Semicolon) + && peek(-1)->type() != lexeme::Semicolon + // this last peek(-1)-condition is a hack (? or is it just + // maybe elegant? I'm torn) so that code like + // + // callback := :(inout x:_) = x += "suffix"; ; + // + // doesn't need the redundant semicolon at the end of a decl... + // there's probably a cleaner way to do it, but this works and + // it doesn't destabilize any regression tests + ) + { + return {}; + } + if ( + !done() + && curr().type() == lexeme::Semicolon + ) + { + n->has_semicolon = true; + next(); + } + return n; + } + + + //G selection-statement: + //G 'if' 'constexpr'? logical-or-expression compound-statement + //G 'if' 'constexpr'? logical-or-expression compound-statement 'else' compound-statement + //G + auto selection_statement() + -> std::unique_ptr<selection_statement_node> + { + if ( + curr().type() != lexeme::Keyword + || curr() != "if" + ) + { + return {}; + } + auto n = std::make_unique<selection_statement_node>(); + n->identifier = &curr(); + next(); + + if ( + curr().type() == lexeme::Keyword + && curr() == "constexpr" + ) + { + n->is_constexpr = true; + next(); + } + + if (auto e = logical_or_expression()) { + n->expression = std::move(e); + } + else { + error("invalid if condition", true, {}, true); + return {}; + } + + if (curr().type() != lexeme::LeftBrace) { + error("an if branch body must be enclosed with { }"); + return {}; + } + + if (auto s = compound_statement()) { + n->true_branch = std::move(s); + } + else { + error("invalid if branch body", true, {}, true); + return {}; + } + + if ( + curr().type() != lexeme::Keyword + || curr() != "else" + ) + { + // Add empty else branch to simplify processing elsewhere + // Note: Position (0,0) signifies it's implicit (no source location) + n->false_branch = + std::make_unique<compound_statement_node>( source_position(0,0) ); + } + else { + n->else_pos = curr().position(); + next(); + + if ( + curr().type() != lexeme::LeftBrace + && curr() != "if" + ) + { + error("an else branch body must be enclosed with { }"); + return {}; + } + + if (auto s = compound_statement( source_position{}, true )) { + n->false_branch = std::move(s); + n->has_source_false_branch = true; + } + else { + error("invalid else branch body", true, {}, true); + return {}; + } + } + + return n; + } + + + //G return-statement: + //G return expression? ';' + //G + auto return_statement() + -> std::unique_ptr<return_statement_node> + { + if ( + curr().type() != lexeme::Keyword + || curr() != "return" + ) + { + return {}; + } + + auto n = std::make_unique<return_statement_node>(); + n->identifier = &curr(); + next(); + + // If there's no optional return expression, we're done + if (curr().type() == lexeme::Semicolon) { + next(); + return n; + } + + // Handle the return expression + auto x = expression(); + if (!x) { + error("invalid return expression", true, {}, true); + return {}; + } + n->expression = std::move(x); + + // Final semicolon + if (curr().type() != lexeme::Semicolon) { + error("missing ; after return"); + next(); + return {}; + } + + next(); + return n; + } + + + //G iteration-statement: + //G label? 'while' logical-or-expression next-clause? compound-statement + //G label? 'do' compound-statement next-clause? 'while' logical-or-expression ';' + //G label? 'for' expression next-clause? 'do' unnamed-declaration + //G + //G label: + //G identifier ':' + //G + //G next-clause: + //G 'next' assignment-expression + //G + auto iteration_statement() + -> std::unique_ptr<iteration_statement_node> + { + auto n = std::make_unique<iteration_statement_node>(); + + // If the next three tokens are: + // identifier ':' 'for/while/do' + // then it's a labeled iteration statement + if ( + curr().type() == lexeme::Identifier + && peek(1) + && peek(1)->type() == lexeme::Colon + && peek(2) + && peek(2)->type() == lexeme::Keyword + && (*peek(2) == "while" || *peek(2) == "do" || *peek(2) == "for") + ) + { + n->label = &curr(); + next(); + next(); + } + + if ( + curr().type() != lexeme::Keyword + || (curr() != "while" && curr() != "do" && curr() != "for") + ) + { + return {}; + } + + n->identifier = &curr(); + next(); + + //----------------------------------------------------------------- + // We'll do these same things in different orders, + // so extract them into local functions... + auto handle_optional_next_clause = [&]() -> bool { + if (curr() != "next") { + return true; // absent next clause is okay + } + next(); // don't bother remembering "next" token, shouldn't need its position info + auto next = assignment_expression(); + if (!next) { + error("invalid expression after 'next'", true, {}, true); + return false; + } + n->next_expression = std::move(next); + return true; + }; + + auto handle_logical_expression = [&]() -> bool { + auto x = logical_or_expression(); + if (!x) { + error("a loop must have a valid conditional expression"); + return false; + } + n->condition = std::move(x); + return true; + }; + + auto handle_compound_statement = [&]() -> bool { + auto s = compound_statement(); + if (!s) { + error("invalid while loop body", true, {}, true); + return false; + } + n->statements = std::move(s); + return true; + }; + //----------------------------------------------------------------- + + // Handle "while" + // + if (*n->identifier == "while") + { + if (!handle_logical_expression ()) { return {}; } + if (!handle_optional_next_clause()) { return {}; } + if (!handle_compound_statement ()) { return {}; } + if (!done() && curr().type() == lexeme::Semicolon) { + error("a loop body may not be followed by a semicolon (empty statements are not allowed)"); + return {}; + } + return n; + } + + // Handle "do" + // + else if (*n->identifier == "do") + { + if (!handle_compound_statement ()) { return {}; } + if (!handle_optional_next_clause()) { return {}; } + if (curr() != "while") { + error("do loop body must be followed by 'while'"); + return {}; + } + next(); + if (!handle_logical_expression ()) { return {}; } + if (curr().type() != lexeme::Semicolon) { + error("missing ; after do..while loop condition"); + next(); + return {}; + } + next(); + return n; + } + + // Handle "for" + // + else if (*n->identifier == "for") + { + n->range = expression(); + if (!n->range) { + error("expected valid range expression after 'for'", true, {}, true); + return {}; + } + + if (!handle_optional_next_clause()) { return {}; } + + if ( + curr() != "do" + || !peek(1) + || peek(1)->type() != lexeme::LeftParen + ) + { + next(); + if (curr().type() == lexeme::Colon) { + error("alpha design change note: 'for range' syntax has changed - please remove ':' and '=', for example: for args do (arg) std::cout << arg;"); + } + else { + error("'for range' must be followed by 'do ( parameter )'"); + } + return {}; + } + next(2); // eat 'do' and '(' + + n->parameter = parameter_declaration(false, false, false); + if (!n->parameter) { + error("'for range do (' must be followed by a parameter declaration", false, source_position{}, true); + return {}; + } + + if (curr().type() != lexeme::RightParen) { + error("expected ')' after 'for' parameter"); + return {}; + } + next(); // eat ')' + + n->body = statement(); + if (!n->body) { + error("invalid for..do loop body", false, source_position{}, true); + return {}; + } + // else + if (n->parameter->pass == passing_style::in) { + n->for_with_in = true; + } + + if (!done() && curr().type() == lexeme::Semicolon) { + error("a loop body may not be followed by a semicolon (empty statements are not allowed)"); + return {}; + } + + return n; + } + + assert(!"compiler bug: unexpected case"); + return {}; + } + + + //G alternative: + //G alt-name? is-type-constraint '=' statement + //G alt-name? is-value-constraint '=' statement + //G alt-name? as-type-cast '=' statement + //G + //GTODO alt-name: + //G unqualified-id ':' + //G + auto alternative() + -> std::unique_ptr<alternative_node> + { + auto n = std::make_unique<alternative_node>(); + + if ( + curr().type() == lexeme::Identifier + && peek(1) + && peek(1)->type() == lexeme::Colon + ) + { + error("(temporary alpha limitation) declaring an identifier is not supported yet"); + return {}; + } + + // Now we should be as "is" or "as" + // (initial partial implementation, just "is/as id-expression") + if ( + curr() != "is" + && curr() != "as" + ) + { + return {}; + } + + n->is_as_keyword = &curr(); + next(); + + if (auto id = type_id()) { + n->type_id = std::move(id); + } + else if (auto e = postfix_expression()) { + n->value = std::move(e); + } + else { + error("expected type-id or value after 'is' in inspect alternative", true, {}, true); + return {}; + } + + if (curr().type() != lexeme::Assignment) { + error("expected = at start of inspect alternative body", true, {}, true); + return {}; + } + n->equal_sign = curr().position(); + next(); + + if (auto s = statement(true, n->equal_sign)) { + n->statement = std::move(s); + } + else { + error("expected statement after = in inspect alternative", true, {}, true); + return {}; + } + + return n; + } + + + //G inspect-expression: + //G 'inspect' 'constexpr'? expression '{' alternative-seq? '}' + //G 'inspect' 'constexpr'? expression '->' type-id '{' alternative-seq? '}' + //G + //G alternative-seq: + //G alternative + //G alternative-seq alternative + //G + auto inspect_expression(bool is_expression) + -> std::unique_ptr<inspect_expression_node> + { + if (curr() != "inspect") { + return {}; + } + + if (!is_expression) { + errors.emplace_back( + curr().position(), + "(temporary alpha limitation) cppfront is still learning 'inspect' - only inspect expressions are currently supported" + ); + return {}; + } + + auto n = std::make_unique<inspect_expression_node>(); + n->identifier = &curr(); + next(); + + if (curr() == "constexpr") { + n->is_constexpr = true; + next(); + } + + if (auto e = expression(true, false)) { + n->expression = std::move(e); + } + else { + error("invalid inspect expression", true, {}, true); + return {}; + } + + // Handle the optional explicit return type + if (curr().type() == lexeme::Arrow) + { + if (!is_expression) { + error("an inspect statement cannot have an explicit return type (whereas an inspect expression must have one)"); + return {}; + } + next(); + if (curr().type() == lexeme::LeftParen) { + error("multiple/named returns are not currently allowed for inspect"); + return {}; + } + + auto type = type_id(); + if (!type) { + error("expected a valid inspect return type after ->"); + return {}; + } + n->result_type = std::move(type); + } + else if (is_expression) { + error("an inspect expression must have an explicit '-> result_type'"); + return {}; + } + + // Now do the inspect body + if (curr().type() != lexeme::LeftBrace) { + error("expected { at start of inspect body"); + return {}; + } + n->open_brace = curr().position(); + next(); + + while (curr().type() != lexeme::RightBrace) + { + auto a = alternative(); + if (!a) { + error("invalid alternative in inspect", true, {}, true); + return {}; + } + if ( + is_expression + && !a->statement->is_expression() + ) + { + error("an inspect expression alternative must be just an expression " + "(not a braced block) that will be used as the value of the inspect expression"); + return {}; + } + n->alternatives.push_back( std::move(a) ); + } + + n->close_brace = curr().position(); + next(); + + if (n->alternatives.empty()) { + error("inspect body cannot be empty - add at least one alternative"); + return {}; + } + + return n; + } + + + //G jump-statement: + //G 'break' identifier? ';' + //G 'continue' identifier? ';' + //G + auto jump_statement() + -> std::unique_ptr<jump_statement_node> + { + auto n = std::make_unique<jump_statement_node>(); + + if ( + curr() != "break" + && curr() != "continue" + ) + { + return {}; + } + + n->keyword = &curr(); + next(); + + if (curr().type() == lexeme::Identifier) { + n->label = &curr(); + next(); + } + + if (curr().type() != lexeme::Semicolon) { + error("expected ; at end of jump-statement"); + return {}; + } + next(); + + return n; + } + + + //G using-statement: + //G 'using' id-expression ';' + //G 'using' 'namespace' id-expression ';' + //G + auto using_statement() + -> std::unique_ptr<using_statement_node> + { + auto n = std::make_unique<using_statement_node>(); + + if (curr() != "using") { + return {}; + } + n->keyword = &curr(); + next(); + + if (curr() == "namespace") { + n->for_namespace = true; + next(); + } + + auto id = id_expression(); + if (!id) { + error(std::string{"expected valid id-expression after 'using"} + (n->for_namespace ? " namespace" : "") + "'"); + return {}; + } + + n->id = std::move(id); + + if (curr().type() != lexeme::Semicolon) { + error("expected ; at end of using-statement"); + return {}; + } + next(); + + return n; + } + + + //G statement: + //G selection-statement + //G using-statement + //G inspect-expression + //G return-statement + //G jump-statement + //G iteration-statement + //G compound-statement + //G contract-statement + //G declaration + //G expression-statement + //G + //G contract-statement + //G contract ';' + // + //GTODO try-block + //G + auto statement( + bool semicolon_required = true, + source_position equal_sign = source_position{}, + bool parameters_allowed = false, + compound_statement_node* compound_parent = nullptr + ) + -> std::unique_ptr<statement_node> + { + if (!done() && curr().type() == lexeme::Semicolon) { + error("empty statement is not allowed - remove extra semicolon"); + return {}; + } + + auto n = std::make_unique<statement_node>(compound_parent); + + // If a parameter list is allowed here, try to parse one + if (parameters_allowed) { + n->parameters = parameter_declaration_list(false, true, false, true); + if (n->parameters) { + for (auto& param : n->parameters->parameters) { + if ( + param->direction() != passing_style::in + && param->direction() != passing_style::inout + && param->direction() != passing_style::copy + ) + { + error("(temporary alpha limitation) parameters scoped to a block/statement must be 'in' (the default), 'copy', or 'inout'", false); + return {}; + } + } + } + } + + // Now handle the rest of the statement + + if (auto s = selection_statement()) { + n->statement = std::move(s); + assert (n->is_selection()); + return n; + } + + else if (auto s = using_statement()) { + n->statement = std::move(s); + assert (n->is_using()); + return n; + } + + else if (auto i = inspect_expression(false)) { + n->statement = std::move(i); + assert (n->is_inspect()); + return n; + } + + else if (auto s = return_statement()) { + n->statement = std::move(s); + assert (n->is_return()); + return n; + } + + else if (auto s = jump_statement()) { + n->statement = std::move(s); + assert (n->is_jump()); + return n; + } + + else if (auto s = iteration_statement()) { + n->statement = std::move(s); + assert (n->is_iteration()); + return n; + } + + else if (auto s = compound_statement(equal_sign)) { + n->statement = std::move(s); + assert (n->is_compound()); + return n; + } + + else if (auto s = contract()) { + if (*s->kind != "assert") { + error("only 'assert' contracts are allowed at statement scope"); + return {}; + } + if (curr().type() != lexeme::Semicolon) { + error("missing ';' after contract-statement"); + return {}; + } + next(); + n->statement = std::move(s); + assert (n->is_contract()); + return n; + } + + else if (auto s = declaration(true, false, false, n.get())) { + n->statement = std::move(s); + assert (n->is_declaration()); + return n; + } + + else if (auto s = expression_statement(semicolon_required)) { + n->statement = std::move(s); + assert (n->is_expression()); + return n; + } + + else { + return {}; + } + } + + + //G compound-statement: + //G '{' statement-seq? '}' + //G + //G statement-seq: + //G statement + //G statement-seq statement + //G + auto compound_statement( + source_position equal_sign = source_position{}, + bool allow_single_unbraced_statement = false + ) + -> std::unique_ptr<compound_statement_node> + { + bool is_braced = curr().type() == lexeme::LeftBrace; + if ( + !is_braced + && !allow_single_unbraced_statement + ) + { + return {}; + } + + auto n = std::make_unique<compound_statement_node>(); + if (!is_braced) { + n->body_indent = curr().position().colno-1; + } + else if (peek(1)) { + n->body_indent = peek(1)->position().colno-1; + } + + // Remember current position, in case this isn't a valid statement + auto start_pos = pos; + + // In the case where this is a declaration initializer with + // = { + // on the same line, we want to remember our start position + // as where the = was, not where the { was + if (equal_sign.lineno == curr().position().lineno) { + n->open_brace = equal_sign; + } + else { + n->open_brace = curr().position(); + } + + if (is_braced) { + next(); + } + + while ( + curr().type() != lexeme::RightBrace + && ( + is_braced + || std::ssize(n->statements) < 1 + ) + ) + { + // Only inside a compound-statement, a + // contained statement() may have parameters + auto s = statement(true, source_position{}, true, n.get()); + if (!s) { + + // Only add error when no specific one already exist + if(!has_error()) { + error("invalid statement encountered inside a compound-statement", true); + } + pos = start_pos; // backtrack + return {}; + } + n->statements.push_back( std::move(s) ); + } + + if (is_braced) { + assert(curr().type() == lexeme::RightBrace); + n->close_brace = curr().position(); + next(); + } + return n; + } + + + //G parameter-declaration: + //G this-specifier? parameter-direction? declaration + //G + //G parameter-direction: one of + //G 'in' 'copy' 'inout' 'out' 'move' 'forward' + //G + //G this-specifier: + //G 'implicit' + //G 'virtual' + //G 'override' + //G 'final' + //G + auto parameter_declaration( + bool is_returns = false, + bool is_named = true, + bool is_template = true, + bool is_statement = false + ) + -> std::unique_ptr<parameter_declaration_node> + { + // Remember current position, because we may need to backtrack if this is just + // a parenthesized expression statement, not a statement parameter list + auto start_pos = pos; + + auto n = std::make_unique<parameter_declaration_node>(); + n->pass = + is_returns ? passing_style::out : + passing_style::in; + n->pos = curr().position(); + + // Handle optional this-specifier + // + if (curr() == "implicit") { + n->mod = parameter_declaration_node::modifier::implicit; + next(); + } + else if (curr() == "virtual") { + n->mod = parameter_declaration_node::modifier::virtual_; + next(); + } + else if (curr() == "override") { + n->mod = parameter_declaration_node::modifier::override_; + next(); + } + else if (curr() == "final") { + n->mod = parameter_declaration_node::modifier::final_; + next(); + } + + // Handle optional parameter-direction + // + if (auto dir = to_passing_style(curr()); + dir != passing_style::invalid + ) + { + if (is_template) { + error("a template parameter cannot have a passing style (it is always implicitly 'in')"); + return {}; + } + + if (is_returns) + { + if (dir == passing_style::in) { + error("a return value cannot be 'in'"); + return {}; + } + if (dir == passing_style::copy) { + error("a return value cannot be 'copy'"); + return {}; + } + if (dir == passing_style::inout) { + error("a return value cannot be 'inout'"); + return {}; + } + if (dir == passing_style::move) { + error("a return value cannot be 'move' (it is implicitly 'move'-out)"); + return {}; + } + } + if ( + !is_named + && dir == passing_style::out + ) + { + error("(temporary alpha limitation) an unnamed function cannot have an 'out' parameter"); + return {}; + } + n->pass = dir; + next(); + } + + // Now the main declaration + // + if (!(n->declaration = declaration(false, true, is_template))) { + pos = start_pos; // backtrack + return {}; + } + + // And some error checks + // + if ( + n->mod != parameter_declaration_node::modifier::none + && !n->declaration->has_name("this") + ) + { + error( "only a 'this' parameter may be declared implicit, virtual, override, or final", false ); + } + + if ( + n->declaration->has_name("this") + && n->pass != passing_style::in + && n->pass != passing_style::inout + && n->pass != passing_style::out + && n->pass != passing_style::move + ) + { + error( "a 'this' parameter must be in, inout, out, or move", false ); + } + + if ( + n->declaration->has_name("that") + && n->pass != passing_style::in + && n->pass != passing_style::move + ) + { + error( "a 'that' parameter must be in or move", false ); + } + + // The only parameter type that could be const-qualified is a 'copy' parameter, because + // only it is always truly its own variable, so it makes sense to let the user qualify it; + // all the other parameter types are conceptually (usually actually) bound to their args + if ( + !is_returns + && n->declaration->is_const() + && n->pass != passing_style::copy + && n->pass != passing_style::inout + ) + { + switch (n->pass) { + break;case passing_style::in: + error( "an 'in' parameter is always const, 'const' isn't needed and isn't allowed", false ); + break;case passing_style::inout: + // error( "an 'inout' parameter can't be const, if you do want it to be const then use 'in' instead", false ); + break;case passing_style::out: + error( "an 'out' parameter can't be const, otherwise it can't be initialized in the function body", false ); + break;case passing_style::move: + error( "a 'move' parameter can't be const, otherwise it can't be moved from in the function body", false ); + break;case passing_style::forward: + error( "a 'forward' parameter shouldn't be const, because it passes along the argument's actual const-ness (and actual value category)", false ); + break;default: + assert (!"ICE: missing case"); + } + return {}; + } + + if ( + !is_returns + && !is_statement + && n->declaration->initializer + ) + { + error("Cpp2 is currently exploring the path of not allowing default arguments - use overloading instead", false); + return {}; + } + if (is_named && is_returns) { + auto tok = n->name(); + assert(tok); + if (tok->type() != lexeme::Identifier) { + error("expected identifier, not '" + tok->to_string() + "'", + false, tok->position()); + } + else if (n->declaration->has_wildcard_type()) { + error("return parameter '" + tok->to_string() + "' must have a type", + false, tok->position()); + } + } + return n; + } + + + //G parameter-declaration-list + //G '(' parameter-declaration-seq? ')' + //G + //G parameter-declaration-seq: + //G parameter-declaration + //G parameter-declaration-seq ',' parameter-declaration + //G + auto parameter_declaration_list( + bool is_returns = false, + bool is_named = true, + bool is_template = false, + bool is_statement = false + ) + -> std::unique_ptr<parameter_declaration_list_node> + { + // Remember current position, because we need to look ahead in + // the case of seeing whether a local statement starts with a + // parameter list, since finding that it doesn't (it's some other + // parenthesized expression) is not an error, just backtrack + auto start_pos = pos; + + auto opener = lexeme::LeftParen; + auto closer = lexeme::RightParen; + if (is_template) { + opener = lexeme::Less; + closer = lexeme::Greater; + } + + if (curr().type() != opener) { + return {}; + } + + auto n = std::make_unique<parameter_declaration_list_node>(); + n->open_paren = &curr(); + next(); + + auto param = std::make_unique<parameter_declaration_node>(); + + auto count = 1; + auto expect_another_param_decl = false; + + while ((param = parameter_declaration(is_returns, is_named, is_template, is_statement)) != nullptr) + { + expect_another_param_decl = false; + param->ordinal = count; + ++count; + + if ( + std::ssize(n->parameters) > 1 + && n->parameters.back()->has_name("that") + ) + { + error("'that' may not be followed by any additional parameters", false); + } + + n->parameters.push_back( std::move(param) ); + + if (curr().type() == closer) { + break; + } + else if (curr().type() != lexeme::Comma) { + if (is_statement) { + pos = start_pos; // backtrack + } + else { + error("expected ',' in parameter list", true, {}, true); + } + return {}; + } + + expect_another_param_decl = true; + next(); + } + + if (expect_another_param_decl) { + error("invalid parameter list: a comma must be followed by another parameter", true, {}, true); + } + + if (curr().type() != closer) { + if (is_statement) { + pos = start_pos; // backtrack + } + else { + error("invalid parameter list", true, {}, true); + } + return {}; + } + + n->close_paren = &curr(); + next(); + return n; + } + + + //G contract: + //G contract-kind contract-group? ':' '(' logical-or-expression ')' + //G contract-kind contract-group? ':' '(' logical-or-expression ',' expression ')' + //G + //G contract-group: + //G '<' id-expression contract-flags?'>' + //G + //G contract-flags: + //G ',' id-expression contract-flags? + //G + //G contract-kind: one of + //G 'pre' 'post' 'assert' + //G + auto contract() + -> std::unique_ptr<contract_node> + { + auto n = std::make_unique<contract_node>(curr().position()); + auto guard = capture_groups_stack_guard(this, &n->captures); + + if ( + curr() != "pre" + && curr() != "post" + && curr() != "assert" + ) + { + return {}; + } + n->kind = &curr(); + next(); + + // Check if there's a <group,flags> + if (curr().type() == lexeme::Less) { + next(); + if (auto id = id_expression()) { + n->group = std::move(id); + } + else { + error("invalid contract group after '<'"); + return {}; + } + + // Now check if there's a list of flags + while (curr().type() == lexeme::Comma) { + next(); + if (auto id = id_expression()) { + n->flags.push_back( std::move(id) ); + } + else { + error("invalid contract tag in list"); + return {}; + } + } + + if (curr().type() != lexeme::Greater) { + error("expected '>' after contract group"); + return {}; + } + next(); + } + + if (curr().type() != lexeme::LeftParen) { + error("expected '(' before the contract condition"); + return {}; + } + next(); + + auto condition = logical_or_expression(); + if (!condition) { + error("invalid contract condition", true, {}, true); + return {}; + } + n->condition = std::move(condition); + + // Now check for the optional string message + if (curr().type() == lexeme::Comma) { + next(); + n->message = expression(); + if (!n->message) { + error("a contract violation message must be a valid string expression", true, {}, true); + return {}; + } + } + + if (curr().type() != lexeme::RightParen) { + error("expected ')' at the end of the contract"); + return {}; + } + next(); + + return n; + } + + + //G function-type: + //G parameter-declaration-list throws-specifier? return-list? contract-seq? + //G + //G throws-specifier: + //G 'throws' + //G + //G return-list: + //G expression-statement + //G '->' parameter-direction? type-id + //G '->' parameter-declaration-list + //G + //G contract-seq: + //G contract + //G contract-seq contract + //G + auto function_type( + declaration_node* my_decl, + bool is_named = true + ) + -> std::unique_ptr<function_type_node> + { + auto n = std::make_unique<function_type_node>( my_decl ); + + // Parameters + auto parameters = parameter_declaration_list(false, is_named, false); + if (!parameters) { + return {}; + } + n->parameters = std::move(parameters); + + // Optional "throws" + if ( + curr().type() == lexeme::Keyword + && curr() == "throws" + ) + { + if ( + n->is_move() + || n->is_swap() + || n->is_destructor() + ) + { + error( "(experimental restriction) Cpp2 currently does not allow a move, swap, or destructor function to be designated 'throws'" ); + return {}; + } + + n->throws = true; + next(); + } + + + // If we're not at a '->' or 'requires' or contract and what follows is + // an expression, this is a ":(params) expr" shorthand function syntax + if ( + curr().type() != lexeme::Arrow + && curr() != "requires" + && (curr() != "pre" && curr() != "post") + ) + { + auto start_pos = pos; + auto at_an_expression = expression() != nullptr; + pos = start_pos; // backtrack no matter what, we're just peeking here + + if (at_an_expression) { + n->returns = function_type_node::single_type_id{ std::make_unique<type_id_node>() }; + assert(n->returns.index() == function_type_node::id); + n->my_decl->terse_no_equals = true; + return n; + } + } + + + // Optional returns + if (curr().type() == lexeme::Arrow) + { + next(); + + if (auto pass = to_passing_style(curr()); + pass != passing_style::invalid + ) + { + if ( + pass != passing_style::forward + && pass != passing_style::move + ) + { + error("only 'forward' and 'move' return passing style are allowed from functions"); + } + next(); + if (auto t = type_id()) { + n->returns = function_type_node::single_type_id{ std::move(t), pass }; + assert(n->returns.index() == function_type_node::id); + } + else { + auto msg = std::string("'"); + msg += to_string_view(pass); + error(msg + "' must be followed by a type-id"); + } + } + + else if (auto t = type_id()) + { + if ( + t->get_token() + && t->get_token()->to_string() == "auto" + ) + { + auto name = std::string{"v"}; + if (my_decl && my_decl->name()) { + name = my_decl->name()->to_string(); + } + errors.emplace_back( + curr().position(), + "to define a function " + name + " with deduced return type, write '" + name + ": ( /* arguments */ ) -> _ = { /* function body */ }'" + ); + return {}; + } + n->returns = function_type_node::single_type_id{ std::move(t), passing_style::move }; + assert(n->returns.index() == function_type_node::id); + } + + else if (auto returns_list = parameter_declaration_list(true, is_named)) + { + if (std::ssize(returns_list->parameters) < 1) { + error("an explicit return value list cannot be empty"); + return {}; + } + n->returns = std::move(returns_list); + assert(n->returns.index() == function_type_node::list); + } + + else + { + error("missing function return after ->"); + return {}; + } + } + + // Pre/post conditions + while (auto c = contract()) + { + if ( + *c->kind != "pre" + && *c->kind != "post" + ) + { + error("only 'pre' and 'post' contracts are allowed on functions"); + return {}; + } + n->contracts.push_back( std::move(c) ); + } + + return n; + } + + + auto apply_type_metafunctions( declaration_node& decl ) + -> bool; + + + //G unnamed-declaration: + //G ':' meta-functions-list? template-parameter-declaration-list? function-type requires-clause? '=' statement + //G ':' meta-functions-list? template-parameter-declaration-list? function-type statement + //G ':' meta-functions-list? template-parameter-declaration-list? type-id? requires-clause? '=' statement + //G ':' meta-functions-list? template-parameter-declaration-list? type-id + //G ':' meta-functions-list? template-parameter-declaration-list? 'final'? 'type' requires-clause? '=' statement + //G ':' 'namespace' '=' statement + //G + //G meta-functions-list: + //G '@' id-expression + //G meta-functions-list '@' id-expression + //G + //G requires-clause: + //G # note: for aliases, == is not allowed in expressions until new ( is opened + //G 'requires' logical-or-expression + //G + //G template-parameter-declaration-list + //G '<' parameter-declaration-seq '>' + //G + auto unnamed_declaration( + source_position start, + bool semicolon_required = true, + bool captures_allowed = false, + bool named = false, + bool is_parameter = false, + bool is_template_parameter = false, + std::unique_ptr<unqualified_id_node> id = {}, + accessibility access = {}, + bool is_variadic = false, + statement_node* my_stmt = {} + ) + -> std::unique_ptr<declaration_node> + { + auto n = std::make_unique<declaration_node>( current_declarations.back() ); + n->pos = start; + + n->identifier = std::move(id); + n->access = access; + n->is_variadic = is_variadic; + n->my_statement = my_stmt; + + // If we're in a type scope and the next token is ';', treat this as if + // ': _;' without an initializer. + // This is for type metafunctions that want to use the incomplete name-only + // declaration, and transform it to something else. If unchanged the + // incomplete declaration will be rejected later by sema.check rule. + if ( + n->parent_is_type() + && curr().type() == lexeme::Semicolon + ) + { + n->type = std::make_unique<type_id_node>(); + assert (n->is_object()); + next(); + return n; + } + + // For a template parameter, ':' is not required and + // we default to ': type' + if ( + is_template_parameter + && curr().type() != lexeme::Colon + ) + { + // So invent the "type" token + generated_text.push_back("type"); + generated_tokens->push_back({ + generated_text.back().c_str(), + std::ssize(generated_text.back()), + start, + lexeme::Identifier + }); + + // So we can create the type_node + + auto t = std::make_unique<type_node>( &generated_tokens->back() ); + + n->type = std::move(t); + assert (n->is_type()); + + // That's it, we're done here + return n; + } + + // For 'this' and 'that' parameters ':' is not allowed and we'll use the default ': _' + if ( + n->identifier + && is_parameter + && ( + *n->identifier->identifier == "this" + || *n->identifier->identifier == "that" + ) + && curr().type() == lexeme::Colon + ) + { + error("a 'this' or 'that' parameter knows its type, no ':' is allowed here", false); + return {}; + } + + // For an ordinary parameter, ':' is not required and + // we default to ': _' - i.e., deduced with no initializer + if ( + is_parameter + && curr().type() != lexeme::Colon + ) + { + // So invent the "_" token + generated_text.push_back("_"); + generated_tokens->push_back({ + generated_text.back().c_str(), + std::ssize(generated_text.back()), + start, + lexeme::Identifier + }); + + // So we can create the typeid_id_node and its unqualified_id_node + + auto gen_id = std::make_unique<unqualified_id_node>(); + gen_id->identifier = &generated_tokens->back(); + + auto type = std::make_unique<type_id_node>(); + type->pos = start; + type->id = std::move(gen_id); + + n->type = std::move(type); + assert (n->is_object()); + + // That's it, we're done here + return n; + } + + // Otherwise, the next token must be ':' + if (curr().type() != lexeme::Colon) { + return {}; + } + next(); + + if (curr() == "union") { + error("unsafe 'union' is not supported in Cpp2 - write '@union' to apply Cpp2's safe 'union' type metafunction instead, or use std::variant"); + } + + // Next is an optional metafunctions clause + while (curr() == "@") { + next(); + auto idx = id_expression(); + if (!idx) { + error("'@' must be followed by a metafunction name", false); + return {}; + } + n->metafunctions.push_back( std::move(idx) ); + } + + // Next is an optional template parameter list + if (curr().type() == lexeme::Less) { + auto template_parameters = parameter_declaration_list(false, false, true); + if (!template_parameters) { + error("invalid template parameter list"); + return {}; + } + n->template_parameters = std::move(template_parameters); + } + + auto guard = + captures_allowed + ? std::make_unique<capture_groups_stack_guard>(this, &n->captures) + : std::unique_ptr<capture_groups_stack_guard>() + ; + + auto guard2 = current_declarations_stack_guard(this, n.get()); + + // Next is an an optional type + + auto deduced_type = false; + + // It could be "type", declaring a user-defined type + if ( + curr() == "type" + || ( + curr() == "final" + && peek(1) && *peek(1) == "type" + ) + ) + { + n->type = std::make_unique<type_node>( &curr(), curr() == "final" ); + + if (curr() == "final") { + next(); + } + next(); + + if ( + is_parameter + && !is_template_parameter + ) + { + error("a normal parameter cannot be a 'type' - did you mean to put this in a < > template parameter list?"); + return {}; + } + assert (n->is_type()); + } + + // Or a function type, declaring a function - and tell the function whether it's in a user-defined type + else if (auto t = function_type(n.get(), named)) + { + n->type = std::move(t); + assert (n->is_function()); + + if (!n->metafunctions.empty()) { + errors.emplace_back( + n->metafunctions.front()->position(), + "(temporary alpha limitation) metafunctions are currently not supported on functions, only on types" + ); + return {}; + } + } + + // Or a namespace + else if (curr() == "namespace") + { + n->type = std::make_unique<namespace_node>( &curr() ); + assert (n->type.index() == declaration_node::a_namespace); + next(); + + if (!n->metafunctions.empty()) { + errors.emplace_back( + n->metafunctions.front()->position(), + "(temporary alpha limitation) metafunctions are currently not supported on namespaces, only on types" + ); + return {}; + } + } + + // Or just a type-id, declaring a non-pointer object + else if (auto t = type_id()) + { + if ( + t->get_token() + && t->get_token()->to_string() == "auto" + ) + { + auto name = std::string{"v"}; + if (n->name()) { + name = n->name()->to_string(); + } + errors.emplace_back( + curr().position(), + "to define a variable " + name + " with deduced type, write '" + name + " := /* initializer */;'" + ); + return {}; + } + + n->type = std::move(t); + assert (n->is_object()); + + if (!n->metafunctions.empty()) { + errors.emplace_back( + n->metafunctions.front()->position(), + "(temporary alpha limitation) metafunctions are currently not supported on objects, only on types" + ); + return {}; + } + + if (curr().type() == lexeme::LeftBracket) { + error("C-style array types are not allowed, use std::array instead"); + return {}; + } + } + + // Or nothing, declaring an object of deduced type, + // which we'll represent using an empty type-id + else { + n->type = std::make_unique<type_id_node>(); + assert (n->is_object()); + deduced_type = true; + } + + // If we've already validated that this is a function where the parameter + // list is followed by a valid expression-statement, parse that again + // (requiring a semicolon as we validated when determining terse_no_equals) + if (n->terse_no_equals) + { + n->equal_sign = curr().position(); + n->initializer = statement(/*ignore semicolon_required*/ false, n->equal_sign); + assert( n->initializer && "ICE: should have already validated that there's a valid expression-statement here" ); + } + + else + { + // Next is optionally a requires clause (if not using the "-> expr;" syntax) + if (curr() == "requires") + { + if ( + n->is_type() + && !n->template_parameters + ) + { + error("'requires' is not allowed on a type that does not have a template parameter list"); + return {}; + } + + if (n->is_namespace()) + { + error("'requires' is not allowed on a namespace"); + return {}; + } + + n->requires_pos = curr().position(); + next(); + auto e = logical_or_expression(); + if (!e) { + error("'requires' must be followed by an expression"); + return {}; + } + n->requires_clause_expression = std::move(e); + } + + // Next is optionally = or == followed by an initializer + + // If there is no = or == + if ( + !done() + && curr().type() != lexeme::Assignment + && curr().type() != lexeme::EqualComparison + ) + { + if ( + n->is_type() + && !is_template_parameter + ) + { + error("a user-defined type must have an = initializer"); + return {}; + } + + // Then there may be a semicolon + // If there is a semicolon, eat it + if (!done() && curr().type() == lexeme::Semicolon) { + next(); + } + // But if there isn't one and it was required, diagnose an error + else if (semicolon_required) { + if (curr().type() == lexeme::LeftBrace) { + error("expected '=' before '{' - did you mean '= {' ?", true, {}, true); + } + else { + error("missing ';' at end of declaration or '=' at start of initializer", true, {}, true); + } + return {}; + } + } + + // There was an = or ==, so eat it and continue + else + { + n->equal_sign = curr().position(); + + if (curr().type() == lexeme::EqualComparison) { + if (!n->is_function()) { + error("syntax error at '==' - did you mean '='?"); + } + n->is_constexpr = true; + } + + next(); + + if (auto t = std::get_if<declaration_node::an_object>(&n->type); + t + && (*t)->is_pointer_qualified() + ) + { + if ( + curr() == "nullptr" + || isdigit(std::string_view(curr())[0]) + || ( + curr() == "(" + && peek(1) + && *peek(1) == ")" + ) + ) + { + error("pointer cannot be initialized to null or int - leave it uninitialized and then set it to a non-null value when you have one"); + violates_lifetime_safety = true; + throw std::runtime_error("null initialization detected"); + } + } + + // deduced_type == true means that the type will be deduced, + // represented using an empty type-id + if ( + deduced_type + && peek(1) + ) + { + auto& type = std::get<declaration_node::an_object>(n->type); + // object initialized by the address of the curr() object + if (peek(1)->type() == lexeme::Ampersand) { + type->address_of = &curr(); + } + // object initialized by (potentially multiple) dereference of the curr() object + else if (peek(1)->type() == lexeme::Multiply) { + type->dereference_of = &curr(); + for (int i = 1; peek(i)->type() == lexeme::Multiply; ++i) + type->dereference_cnt += 1; + } + else if ( + // object initialized by the result of the function call (and it is not unnamed function) + (peek(1)->type() == lexeme::LeftParen && curr().type() != lexeme::Colon) + || curr().type() == lexeme::Identifier // or by the object (variable that the type need to be checked) + ) { + type->suspicious_initialization = &curr(); + } + } + + if (!(n->initializer = statement(semicolon_required, n->equal_sign))) { + error( + "ill-formed initializer", + true, {}, true + ); + next(); + return {}; + } + } + + } + + // A type initializer must be a compound expression + if ( + n->is_type() + && !is_parameter + && ( + !n->initializer + || !n->initializer->is_compound() + ) + ) + { + errors.emplace_back( + n->position(), + "a user-defined type initializer must be a compound-expression consisting of declarations" + ); + return {}; + } + + // If this is a type with metafunctions, apply those + if (n->is_type()) { + if (!apply_type_metafunctions(*n)) { + error( + "error encountered while applying type metafunctions", + false, {}, true + ); + return {}; + } + } + + if ( + n->is_function() + && n->initializer + && !done() && curr().type() == lexeme::Semicolon + ) + { + if (n->initializer->is_compound() && n->has_name()) { + error("a braced function body may not be followed by a semicolon (empty statements are not allowed)"); + return {}; + } else if (n->initializer->is_expression()) { + error("a single-expression function should end with a single semicolon"); + return {}; + } + } + + // If this is a function with a list of multiple/named return values, + // and the function body's end doesn't already have "return" as the + // last statement, then generate "return;" as the last statement + if (auto func = std::get_if<declaration_node::a_function>(&n->type); + func + && n->initializer + && (*func)->returns.index() == function_type_node::list + ) + { + if (!n->initializer->is_compound()) { + error( + "a function with named return value(s) must have a full { } body", + false, + {}, + true + ); + return {}; + } + + auto& body = std::get<statement_node::compound>(n->initializer->statement); + + if ( + body->statements.empty() + || !body->statements.back()->is_return() + ) + { + auto last_pos = n->position(); + if (!body->statements.empty()) { + last_pos = body->statements.back()->position(); + } + ++last_pos.lineno; + generated_tokens->emplace_back( "return", last_pos, lexeme::Keyword); + + auto ret = std::make_unique<return_statement_node>(); + ret->identifier = &generated_tokens->back(); + + auto stmt = std::make_unique<statement_node>(); + stmt->statement = std::move(ret); + + body->statements.push_back(std::move(stmt)); + } + } + + // If this is a function, record its extents + if (n->is_function()) { + function_body_extents.emplace_back( + n->equal_sign.lineno, + peek(-1)->position().lineno + ); + } + + return n; + } + + + //G alias: + //G ':' template-parameter-declaration-list? 'type' requires-clause? '==' type-id ';' + //G ':' 'namespace' '==' id-expression ';' + //G ':' template-parameter-declaration-list? type-id? requires-clause? '==' expression ';' + //G + //GT ':' function-type '==' expression ';' + //GT # See commit 63efa6ed21c4d4f4f136a7a73e9f6b2c110c81d7 comment + //GT # for why I don't see a need to enable this yet + // + auto alias() + -> std::unique_ptr<declaration_node> + { + // Remember current position, because we need to look ahead + auto start_pos = pos; + + auto n = std::make_unique<declaration_node>( current_declarations.back() ); + + if (curr().type() != lexeme::Colon) { + return {}; + } + next(); + + // Next is an optional template parameter list + if (curr().type() == lexeme::Less) { + auto template_parameters = parameter_declaration_list(false, false, true); + if (!template_parameters) { + pos = start_pos; // backtrack + return {}; + } + n->template_parameters = std::move(template_parameters); + } + + auto a = std::make_unique<alias_node>( &curr() ); + + // Next must be 'type', 'namespace', a type-id, or we're at the 'requires' or '==' + if (curr() == "type") + { + next(); + } + else if (curr() == "namespace") + { + next(); + if (n->template_parameters) { + errors.emplace_back( + curr().position(), + "a namespace or namespace alias cannot have template parameters" + ); + return {}; + } + } + else if (curr().type() != lexeme::EqualComparison && curr() != "requires") + { + a->type_id = type_id(); + if (!a->type_id) { + pos = start_pos; // backtrack + return {}; + } + } + + // Next is optionally a requires clause + if (curr() == "requires") + { + if ( + n->is_type_alias() + && !n->template_parameters + ) + { + error("'requires' is not allowed on a type alias that does not have a template parameter list"); + return {}; + } + + if (n->is_namespace_alias()) + { + error("'requires' is not allowed on a namespace alias"); + return {}; + } + + n->requires_pos = curr().position(); + next(); + auto e = logical_or_expression(true, false); + if (!e) { + error("'requires' must be followed by an expression"); + return {}; + } + n->requires_clause_expression = std::move(e); + } + + // Now we should be at the '==' if this is an alias + + if (curr().type() == lexeme::EqualComparison) { + next(); + } + else { + if (a->type->type() != lexeme::EqualComparison) { + pos = start_pos; // backtrack + return {}; + } + } + assert(peek(-1)->type() == lexeme::EqualComparison); + + if ( + n->parent_is_type() + && *a->type == "namespace" + ) + { + errors.emplace_back( + curr().position(), + "a namespace alias cannot appear in a type scope" + ); + return {}; + } + + // Finally, pick up the initializer + + // Type alias + if (*a->type == "type") + { + auto t = type_id(); + if (!t) { + errors.emplace_back( + curr().position(), + "a 'type ==' alias declaration must be followed by a type name" + ); + return {}; + } + if ( + t->is_wildcard() + || ( t->get_token() && t->get_token()->to_string() == "auto" ) + ) { + errors.emplace_back( + curr().position(), + "a 'type ==' alias declaration must be followed by a type name (not a wildcard _ nor auto)" + ); + return {}; + } + a->initializer = std::move(t); + } + + // Namespace alias + else if (*a->type == "namespace") + { + if (auto qid = id_expression()) { + a->initializer = std::move(qid); + } + else { + errors.emplace_back( + curr().position(), + "a 'namespace ==' alias declaration must be followed by a namespace name (id-expression)" + ); + return {}; + } + } + + // Object alias + else if ( + a->type_id + || a->type->type() == lexeme::EqualComparison + ) + { + auto e = expression(); + if (!e) { + errors.emplace_back( + curr().position(), + "an object '==' alias declaration must be followed by an expression" + ); + return {}; + } + a->initializer = std::move(e); + } + + // Anything else shouldn't be possible + else { + assert(!"ICE: should be unreachable - invalid alias declaration"); + return {}; + } + + // And the final ceremonial semicolon + if (curr() != ";") { + errors.emplace_back( + curr().position(), + "';' expected at end of alias declaration" + ); + return {}; + } + next(); + + n->type = std::move(a); + + return n; + } + + + //G declaration: + //G access-specifier? identifier '...'? unnamed-declaration + //G access-specifier? identifier alias + //G + //G access-specifier: + //G public + //G protected + //G private + //G + auto declaration( + bool semicolon_required = true, + bool is_parameter = false, + bool is_template_parameter = false, + statement_node* my_stmt = {} + ) + -> std::unique_ptr<declaration_node> + { + if (done()) { return {}; } + + // Remember current position, because we need to look ahead + auto start_pos = pos; + + auto n = std::unique_ptr<declaration_node>{}; + + // This scope is to ensure that once we've moved 'id' into the + // declaration_node, we don't access the moved-from local name + // (and similar hygiene for 'access' though that one doesn't matter as much) + // The reason to move 'id' into unnamed_declaration() is so that + // it can conveniently perform some checks that refer to the name + { + auto access = accessibility::default_; + if (curr() == "public") { + access = accessibility::public_; + next(); + } + else if (curr() == "protected") { + access = accessibility::protected_; + next(); + } + else if (curr() == "private") { + access = accessibility::private_; + next(); + } + + // If they wrote an access-specifier, see if they put a ':' + // after it out of Cpp1 habit (there's no colon in Cpp2) + if ( + access != accessibility::default_ + && curr().type() == lexeme::Colon + ) + { + errors.emplace_back( + curr().position(), + "':' is not allowed after an access-specifier" + ); + return {}; + } + + auto id = unqualified_id(); + if (!id) { + return {}; + } + + if (id->to_string() == "...") { + errors.emplace_back( + curr().position(), + "a variadic declaration must have a name - did you forget to write a name before '...'?" + ); + pos = start_pos; // backtrack + } + + auto is_variadic = false; + if (curr().type() == lexeme::Ellipsis) { + is_variadic = true; + next(); + } + + // Provide some useful Cpp1->Cpp2 migration diagnostics for common mistakes + // + if ( + id->get_token() + && *id->get_token() == "auto" + && curr().type() != lexeme::Colon + ) + { + auto name = std::string{"v"}; + if (peek(0) && peek(0)->type() == lexeme::Identifier) { + name = peek(0)->to_string(); + } + errors.emplace_back( + curr().position(), + "to define a variable " + name + " of type T, write '" + name + ": T = /* initializer */'" + ); + return {}; + } + if ( + id->get_token() + && *id->get_token() == "namespace" + && curr().type() != lexeme::Colon + ) + { + auto name = std::string{"N"}; + if (peek(0)) { + name = peek(0)->to_string(); + } + errors.emplace_back( + curr().position(), + "to define a namespace " + name + ", write '" + name + " : namespace = { /*contents*/ }'" + ); + return {}; + } + if ( + id->get_token() + && ( + *id->get_token() == "class" + || *id->get_token() == "struct" + ) + && curr().type() != lexeme::Colon + ) + { + auto name = std::string{"C"}; + if (peek(0)) { + name = peek(0)->to_string(); + } + errors.emplace_back( + curr().position(), + "to define a type " + name + ", write '" + name + " : type = { /*body*/ }'" + ); + return {}; + } + + // Now proceed... + // + + // First see if it's an alias declaration + n = alias(); + if (n) { + if (is_parameter) { + errors.emplace_back( + curr().position(), + "a parameter declaration may not be an alias declaration" + ); + return {}; + } + + if (is_variadic) { + errors.emplace_back( + curr().position(), + "an alias declaration may not be variadic" + ); + return {}; + } + + n->pos = start_pos; + n->identifier = std::move(id); + n->access = access; + return n; + } + + // Otherwise, this is a normal declaration + n = unnamed_declaration( + start_pos, + semicolon_required, + false, + true, + is_parameter, + is_template_parameter, + std::move(id), + access, + is_variadic, + my_stmt + ); + if (!n) { + pos = start_pos; // backtrack + return {}; + } + } + + // Note: Do this after trying to parse this as a declaration, for parse backtracking + + if ( + *n->identifier->identifier == "that" + && ( + !is_parameter + || is_template_parameter + ) + ) + { + errors.emplace_back( + n->identifier->position(), + "'that' may only be declared as an ordinary function parameter" + ); + return {}; + } + + // Cache some context + n->is_template_parameter = is_template_parameter; + n->is_parameter = is_parameter; + + return n; + } + + + //G declaration-seq: + //G declaration + //G declaration-seq declaration + //G + //G translation-unit: + //G declaration-seq? + // + auto translation_unit() + -> std::unique_ptr<translation_unit_node> + { + auto n = std::make_unique<translation_unit_node>(); + for (auto d = declaration(); d; d = declaration()) { + n->declarations.push_back( std::move(d) ); + } + return n; + } + +public: + //----------------------------------------------------------------------- + // debug_print + // + auto debug_print(std::ostream& o) + -> void; +}; + + +//----------------------------------------------------------------------- +// +// Common parts for printing visitors +// +//----------------------------------------------------------------------- +// +struct printing_visitor +{ + //----------------------------------------------------------------------- + // Constructor: remember a stream to write to + // + std::ostream& o; + + printing_visitor(std::ostream& out) : o{out} { indent_spaces = 2; } +}; + + +//----------------------------------------------------------------------- +// +// Visitor for printing a parse tree +// +//----------------------------------------------------------------------- +// +class parse_tree_printer : printing_visitor +{ + using printing_visitor::printing_visitor; + +public: + auto start(token const& n, int indent) -> void + { + o << pre(indent) << _as<std::string>(n.type()) << ": " << n.to_string() << "\n"; + } + + auto start(literal_node const&, int indent) -> void + { + o << pre(indent) << "literal" << "\n"; + } + + auto start(expression_node const& n, int indent) -> void + { + o << pre(indent) << "expression - " + << n.num_subexpressions << " subexpressions, my_statement [" + << static_cast<void const*>(n.my_statement) << "]\n"; + } + + auto start(expression_list_node::term const&n, int indent) -> void + { + o << pre(indent) << "expression-list term\n"; + if (n.pass == passing_style::out) { + o << pre(indent+1) << "out\n"; + } + } + + auto start(expression_list_node const&, int indent) -> void + { + o << pre(indent) << "expression-list\n"; + } + + auto start(primary_expression_node const&, int indent) -> void + { + o << pre(indent) << "primary-expression\n"; + } + + auto start(prefix_expression_node const&, int indent) -> void + { + o << pre(indent) << "prefix-expression\n"; + } + + auto start(is_as_expression_node const&, int indent) -> void + { + o << pre(indent) << "is-as-expression\n"; + } + + template<String Name, typename Term> + auto start(binary_expression_node<Name, Term> const&, int indent) -> void + { + o << pre(indent) << Name.value << "-expression\n"; + } + + auto start(expression_statement_node const& n, int indent) -> void + { + o << pre(indent) << "expression-statement - [" << static_cast<void const*>(&n) << "]\n"; + } + + auto start(postfix_expression_node const&, int indent) -> void + { + o << pre(indent) << "postfix-expression\n"; + } + + auto start(unqualified_id_node const&, int indent) -> void + { + o << pre(indent) << "unqualified-id\n"; + } + + auto start(qualified_id_node const&, int indent) -> void + { + o << pre(indent) << "qualified-id\n"; + } + + auto start(type_id_node const&, int indent) -> void + { + o << pre(indent) << "type-id\n"; + } + + auto start(id_expression_node const&, int indent) -> void + { + o << pre(indent) << "id-expression\n"; + } + + auto start(statement_node const&, int indent) -> void + { + o << pre(indent) << "statement\n"; + } + + auto start(compound_statement_node const&, int indent) -> void + { + o << pre(indent) << "compound-statement\n"; + } + + auto start(selection_statement_node const& n, int indent) -> void + { + o << pre(indent) << "selection-statement\n"; + o << pre(indent+1) << "is_constexpr: " << _as<std::string>(n.is_constexpr) << "\n"; + } + + auto start(alternative_node const&, int indent) -> void + { + o << pre(indent) << "alternative\n"; + } + + auto start(jump_statement_node const&, int indent) -> void + { + o << pre(indent) << "jump\n"; + } + + auto start(using_statement_node const& n, int indent) -> void + { + o << pre(indent) << "using" << (n.for_namespace? " namespace" : "") << "\n"; + } + + auto start(inspect_expression_node const& n, int indent) -> void + { + o << pre(indent) << "inspect-expression\n"; + o << pre(indent+1) << "is_constexpr: " << _as<std::string>(n.is_constexpr) << "\n"; + } + + auto start(return_statement_node const&, int indent) -> void + { + o << pre(indent) << "return-statement\n"; + } + + auto start(iteration_statement_node const& n, int indent) -> void + { + o << pre(indent) << "iteration-statement\n"; + assert(n.identifier); + o << pre(indent+1) << "identifier: " << std::string_view(*n.identifier) << "\n"; + } + + auto start(contract_node const& n, int indent) -> void + { + o << pre(indent) << "contract\n"; + assert(n.kind); + o << pre(indent+1) << "kind: " << std::string_view(*n.kind) << "\n"; + if (!n.captures.members.empty()) { + o << pre(indent+1) << "captures: " << n.captures.members.size() << "\n"; + } + } + + auto start(type_node const&, int indent) -> void + { + o << pre(indent) << "user-defined type\n"; + } + + auto start(namespace_node const&, int indent) -> void + { + o << pre(indent) << "namespace\n"; + } + + auto start(function_type_node const& n, int indent) -> void + { + o << pre(indent) << "function\n"; + o << pre(indent+1) << "throws: " << _as<std::string>(n.throws) << "\n"; + if (n.returns.index() == function_type_node::id) { + auto& r = std::get<function_type_node::id>(n.returns); + if (r.pass != passing_style::invalid) { + o << pre(indent+1) << "returns by: " << to_string_view(r.pass) << "\n"; + } + } + } + + auto start(function_returns_tag const&, int indent) -> void + { + o << pre(indent) << "function returns\n"; + } + + auto start(template_args_tag const&, int indent) -> void + { + o << pre(indent) << "template arguments\n"; + } + + auto start(declaration_identifier_tag const&, int indent) -> void + { + o << pre(indent) << "declaration identifier\n"; + } + + auto start(next_expression_tag const&, int indent) -> void + { + o << pre(indent) << "next expression\n"; + } + + auto start(alias_node const& n, int indent) -> void + { + o << pre(indent) << "alias\n"; + switch (n.initializer.index()) { + break;case alias_node::a_type: + o << pre(indent+1) << "type\n"; + break;case alias_node::a_namespace: + o << pre(indent+1) << "namespace\n"; + break;case alias_node::an_object: + o << pre(indent+1) << "object\n"; + break;default: + o << pre(indent+1) << "ICE - invalid variant state\n"; + } + } + + auto start(declaration_node const& n, int indent) -> void + { + o << pre(indent) << "declaration [" << &n << "]\n"; + o << pre(indent+1) << "parent: [" << n.parent_declaration << "]\n"; + o << pre(indent+1) << "is_variadic: [" << std::boolalpha << n.is_variadic << "]\n"; + o << pre(indent+1) << "is_constexpr: " << _as<std::string>(n.is_constexpr) << "\n"; + switch (n.type.index()) { + break;case declaration_node::a_function: + o << pre(indent+1) << "function\n"; + break;case declaration_node::an_object: + o << pre(indent+1) << "object\n"; + break;case declaration_node::a_type: + o << pre(indent+1) << "type\n"; + break;case declaration_node::a_namespace: + o << pre(indent+1) << "namespace\n"; + break;case declaration_node::an_alias: + o << pre(indent+1) << "alias\n"; + break;default: + o << pre(indent+1) << "ICE - invalid variant state\n"; + } + if (!n.is_default_access()) { + o << pre(indent+1) << "access: " << to_string(n.access) << "\n"; + } + if (!n.captures.members.empty()) { + o << pre(indent+1) << "captures: " << n.captures.members.size() << "\n"; + } + } + + auto start(parameter_declaration_node const& n, int indent) -> void + { + o << pre(indent) << "parameter-declaration\n"; + + o << pre(indent+1); + switch (n.pass) { + break;case passing_style::in : o << "in"; + break;case passing_style::copy : o << "copy"; + break;case passing_style::inout : o << "inout"; + break;case passing_style::out : o << "out"; + break;case passing_style::move : o << "move"; + break;case passing_style::forward: o << "forward"; + break;default: ; + } + + o << pre(indent+1); + switch (n.mod) { + break;case parameter_declaration_node::modifier::implicit : o << "implicit"; + break;case parameter_declaration_node::modifier::virtual_ : o << "virtual"; + break;case parameter_declaration_node::modifier::override_ : o << "override"; + break;case parameter_declaration_node::modifier::final_ : o << "final"; + break;default: ; + } + o << "\n"; + + assert( n.declaration ); + } + + auto start(parameter_declaration_list_node const&, int indent) -> void + { + o << pre(indent) << "parameter-declaration-list\n"; + } + + auto start(translation_unit_node const&, int indent) -> void + { + o << pre(indent) << "translation-unit\n"; + } + + auto start(auto const&, int indent) -> void + { + o << pre(indent) << "UNRECOGNIZED -- FIXME\n"; + } + + auto end(auto const&, int) -> void + { + // Ignore other node types + } +}; + + +auto parser::debug_print(std::ostream& o) + + -> void +{ + o << "\n\n--- Parse tree\n"; + + auto tree_printer = parse_tree_printer{o}; + visit( tree_printer ); + + o << "\n\n--- Function body extents\n"; + + for (auto const& f : function_body_extents) { + o << " " << f.first << "-" << f.last << "\n"; + } +} + + +} + +#endif |
